|
|
| | 2-Aminotoluene-5-sulfonic acid Basic information |
| Product Name: | 2-Aminotoluene-5-sulfonic acid | | Synonyms: | 2-TOLUIDINE-5-SULFONIC ACID;2H,2H,3H,3H-PERFLUOROUNDECANOIC ACID;4-AMINO-M-TOLUENESULFONIC ACID;4-AMINO-3-METHYLBENZENESULFONIC ACID;4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-HEPTADECAFLUOROUNDECANOIC ACID;OTS;2H,2H,3H,3H-PERFLUOROUNDECANOIC ACID, 97% MIN.;3-(Heptadecafluorooctyl)propionic acid | | CAS: | 34598-33-9 | | MF: | C11H5F17O2 | | MW: | 492.13 | | EINECS: | 252-108-4 | | Product Categories: | | | Mol File: | 34598-33-9.mol |  |
| | 2-Aminotoluene-5-sulfonic acid Chemical Properties |
| Melting point | 93-97 °C | | Boiling point | 244.9±35.0 °C(Predicted) | | density | 1.652±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly, Heated), Methanol (Slightly) | | pka | 4.22±0.10(Predicted) | | form | Solid | | color | White to Off-Whiite | | Stability: | Hygroscopic | | InChI | InChI=1S/C11H5F17O2/c12-4(13,2-1-3(29)30)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h1-2H2,(H,29,30) | | InChIKey | JZRCRCFPVAXHHQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 34598-33-9(CAS DataBase Reference) | | EPA Substance Registry System | 8:3 Fluorotelomer carboxylic acid (34598-33-9) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 10-21 | | Hazard Note | Corrosive | | HS Code | 2915.90.1800 | | HazardClass | IRRITANT | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |
| | 2-Aminotoluene-5-sulfonic acid Usage And Synthesis |
| Uses | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecanoic Acid is a derivative of Undecanoic Acid (U788850) which is a saturated fatty acid. It may be used to activate orphan G protein-coupled receptor GPR40. |
| | 2-Aminotoluene-5-sulfonic acid Preparation Products And Raw materials |
| Preparation Products | N-Succinimidyl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate |
|