|
|
| | Perfluoroundecanoic acid Basic information |
| Product Name: | Perfluoroundecanoic acid | | Synonyms: | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heneicosafluoroundecanoic acid;Undecanoic acid,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heneicosafluoro-;PFUNA;PERFLUOROUNDECANOIC ACID;perfluoro-n-undecanoicacid;Perfluoroundecanoic acid 96%;Heneicosafluoroundecanoic Acid;Perfluoroundecanoicacid96% | | CAS: | 2058-94-8 | | MF: | C11HF21O2 | | MW: | 564.09 | | EINECS: | 218-165-4 | | Product Categories: | Fluorous Synthesis;Rf-Tagged Building Blocks and Precursors;Specialty Synthesis | | Mol File: | 2058-94-8.mol |  |
| | Perfluoroundecanoic acid Chemical Properties |
| Melting point | 96-101 °C(lit.) | | Boiling point | 160 °C60 mm Hg(lit.) | | density | 1.7568 (estimate) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | powder to crystal | | pka | 0.52±0.10(Predicted) | | color | White to Almost white | | Henry's Law Constant | 1.3×10-2 mol/(m3Pa) at 25℃, Arp et al. (2006) | | InChI | 1S/C11HF21O2/c12-2(13,1(33)34)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)32/h(H,33,34) | | InChIKey | SIDINRCMMRKXGQ-UHFFFAOYSA-N | | SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | Undecanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heneicosafluoro- (2058-94-8) |
| Hazard Codes | Xn,Xi,C | | Risk Statements | 20/21/22-36/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 3261 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | IRRITANT, CORROSIVE | | HS Code | 29159000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Eye Dam. 1
Lact.
Repr. 1B
STOT RE 1 |
| | Perfluoroundecanoic acid Usage And Synthesis |
| Chemical Properties | Perfluoroundecanoic acid exists as a colorless solid. Perfluoroundecanoic acid has the ability to react with oxidizing agents. Upon decomposition, PFUnA can form carbon oxides and hydrogen fluoride. | | Uses | Perfluoroundecanoic acid (PFUnA, perfluoro-n-undecanoic acid, henicosafluoroundecanoic acid) is an eleven-carbon compound in the perfluoroalkyl family of chemicals. Perfluoroundecanoic acid is used in a variety of applications, including in stain- and grease-proof coatings on food packages, furniture, upholstery, and carpet. Like many other perfluoroalkyl compounds, PFUnA persists in the environment due to its long carbon chain. Some research related to PFUnA has been conducted but additional inquiry is recommended for better understanding of how the chemical interacts with organisms and the environment. | | Uses | Perfluorotetradecanoic acid may be used as an analytical reference standard for the quantification of the analyte in water samples using a high-performance liquid chromatography technique. | | Definition | ChEBI: A fluoroalkanoic acid that is perfluorinated undecanoic acid. | | General Description | Perfluoroundecanoic acid belongs to the class of persistent perfluorinated compounds, found in environmental and biological samples. They are used in various commercial applications such as in firefighting foams, detergents, insecticides, paper, food containers as well as to produce photographic films and manufacture fat- and water-resistant fabrics, etc. |
| | Perfluoroundecanoic acid Preparation Products And Raw materials |
|