| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,5-Diphenyl-1,5-pentanedione Basic information |
| Product Name: | 1,5-Diphenyl-1,5-pentanedione | | Synonyms: | TIMTEC-BB SBB008576;RARECHEM AQ A2 0032;1,5-diphenyl-5-pentanedione;1,3-Dibenzoylpropane 98%;1,5-Diphenyl-1,5-pentanedione,99%;1,5-Pentanedione, 1,5-diphenyl-;1,3-DIBENZOYLPROPANE;1,5-DIPHENYLPENTANE-1,5-DIONE | | CAS: | 6263-83-8 | | MF: | C17H16O2 | | MW: | 252.31 | | EINECS: | | | Product Categories: | Building Blocks;C15 to C38;Carbonyl Compounds;Chemical Synthesis;Ketones;Organic Building Blocks | | Mol File: | 6263-83-8.mol |  |
| | 1,5-Diphenyl-1,5-pentanedione Chemical Properties |
| Melting point | 66-68 °C(lit.) | | Boiling point | 355.49°C (rough estimate) | | density | 1.0832 (rough estimate) | | refractive index | 1.5700 (estimate) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Crystalline Powder | | color | White to light beige | | InChI | 1S/C17H16O2/c18-16(14-8-3-1-4-9-14)12-7-13-17(19)15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2 | | InChIKey | YOLLTWVIOASMFW-UHFFFAOYSA-N | | SMILES | O=C(CCCC(=O)c1ccccc1)c2ccccc2 | | EPA Substance Registry System | 1,5-Pentanedione, 1,5-diphenyl- (6263-83-8) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29143900 | | Storage Class | 11 - Combustible Solids |
| | 1,5-Diphenyl-1,5-pentanedione Usage And Synthesis |
| Chemical Properties | WHITE TO LIGHT BEIGE CRYSTALLINE POWDER | | Uses | 1,3-Dibenzoylpropane may be used in the electrochemical synthesis of cis-1,2-diphenyl-1,2-cyclopentanediol, via reduction in acetonitrile. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 38, p. 901, 1973 DOI: 10.1021/jo00945a011
Tetrahedron Letters, 15, p. 3721, 1974 | | General Description | 1,3-Dibenzoylpropane is a 1,3-diaroylpropane. 1,3-Dibenzoylpropane is formed during hydroxocobalt(III) Schiff base complexes catalyzed selective aldol reaction of dibenzoylmethanes with formaldehyde in methanol. |
| | 1,5-Diphenyl-1,5-pentanedione Preparation Products And Raw materials |
|