| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | 1,5-Diphenyl-1,3,5-pentanetrione Basic information |
| Product Name: | 1,5-Diphenyl-1,3,5-pentanetrione | | Synonyms: | 1,3,5-Pentanetrione,1,5-diphenyl-;1,5-di(phenyl)pentane-1,3,5-trione;NSC 154656;NSC 631644;5-pentanetrione,1,5-diphenyl-3;1,3-DIBENZOYLACETONE;1,5-Diphenyl-1,3,5-pentanetrione >=98.0% (T);1,5-Diphenyl-1,3,5-pentanetrione, ≥98% | | CAS: | 1467-40-9 | | MF: | C17H14O3 | | MW: | 266.29 | | EINECS: | | | Product Categories: | Building Blocks;C15 to C38;Carbonyl Compounds;Chemical Synthesis;Ketones;Organic Building Blocks | | Mol File: | 1467-40-9.mol |  |
| | 1,5-Diphenyl-1,3,5-pentanetrione Chemical Properties |
| Melting point | 107-109 °C | | Boiling point | 422.7±20.0 °C(Predicted) | | density | 1.172 | | pka | 7.78±0.23(Predicted) | | BRN | 2054189 | | InChI | 1S/C17H14O3/c18-15(11-16(19)13-7-3-1-4-8-13)12-17(20)14-9-5-2-6-10-14/h1-10H,11-12H2 | | InChIKey | MUNGMRPYTCHBFX-UHFFFAOYSA-N | | SMILES | O=C(CC(=O)c1ccccc1)CC(=O)c2ccccc2 | | EPA Substance Registry System | 1,3,5-Pentanetrione, 1,5-diphenyl- (1467-40-9) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | 1,5-Diphenyl-1,3,5-pentanetrione Usage And Synthesis |
| Uses | 1,5-Diphenyl-1,3,5-pentanetrione (H2DBA, DBAc) is a symmetrical triketone.1,3,5-triketones are potential tridentate ligands and forms complexes with transition metals, lanthanides and actinides. It acts as ligand and forms binuclear cobalt complex with CoCl2.6H2O. The interaction of two intramolecular hydrogen bonds in 1,5-diphenyl-1,3,5-pentanetrione has been studied. H2DBA can be synthesized by condensation reaction between ethyl benzoate and benzoyl acetone. DBAc arranged in stretched polyethylene (PE) sheets has been investigated by infrared linear dichroism (LD) spectroscopy. | | General Description | 1,5-Diphenyl-1,3,5-pentanetrione (H2DBA, DBAc) is a symmetrical triketone.1,3,5-triketones are potential tridentate ligands and forms complexes with transition metals, lanthanides and actinides. It acts as ligand and forms binuclear cobalt complex with CoCl2.6H2O. The interaction of two intramolecular hydrogen bonds in 1,5-diphenyl-1,3,5-pentanetrione has been studied. H2DBA can be synthesized by condensation reaction between ethyl benzoate and benzoyl acetone. DBAc arranged in stretched polyethylene (PE) sheets has been investigated by infrared linear dichroism (LD) spectroscopy. |
| | 1,5-Diphenyl-1,3,5-pentanetrione Preparation Products And Raw materials |
|