| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Triethylhexylammonium bromide Basic information |
| Product Name: | Triethylhexylammonium bromide | | Synonyms: | HEXYLTRIETHYLAMMONIUM BROMIDE;N2226 BR;Triethylhexylammonium bromide 99%;N,N,N-Triethylhexan-1-aminium bromide;Triethylhexylammonium bromide | | CAS: | 13028-71-2 | | MF: | C12H28BrN | | MW: | 266.27 | | EINECS: | | | Product Categories: | | | Mol File: | 13028-71-2.mol |  |
| | Triethylhexylammonium bromide Chemical Properties |
| Melting point | 114-117 °C (lit.) | | InChI | 1S/C12H28N.BrH/c1-5-9-10-11-12-13(6-2,7-3)8-4;/h5-12H2,1-4H3;1H/q+1;/p-1 | | InChIKey | NAWZSHBMUXXTGV-UHFFFAOYSA-M | | SMILES | [Br-].CCCCCC[N+](CC)(CC)CC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Triethylhexylammonium bromide Usage And Synthesis |
| | Triethylhexylammonium bromide Preparation Products And Raw materials |
|