|
|
| | Tetraheptylammonium bromide Basic information |
| Product Name: | Tetraheptylammonium bromide | | Synonyms: | Tetraheptylammonium bromide, 99%, for ion-pair chromatography;1-Heptanaminium, N,N,N-triheptyl-, bromide;n,n,n-triheptyl-1-heptanaminiubromide;TETRAHEPTYLAMMONIUM BROMIDE, FOR ION PAI R CHROMATOGR.;TetraheptylammoniumBromideGrForHplc;TetraheptylAmmoniumBromideGr;TetraheptylammoniumBromide99%;Tetra-n-heptylammoniumbromide,99% | | CAS: | 4368-51-8 | | MF: | C28H60BrN | | MW: | 490.69 | | EINECS: | 224-459-3 | | Product Categories: | Ammonium Bromides (Quaternary);Quaternary Ammonium Compounds;Ammonium Salts;AmmoniumGreener Alternatives: Catalysis;Chemical Synthesis;Ionic Liquids;Ammonium SaltsDetergents;CationicDetergents;Detergents A to Z;Greener Alternatives: Catalysis;Phase Transfer Catalysts;Ion Pair Reagents - Anionic;Ion Pair Reagents;Ion Pair;Chromatography/CE Reagents;AnionicHPLC | | Mol File: | 4368-51-8.mol |  |
| | Tetraheptylammonium bromide Chemical Properties |
| Melting point | 87-89 °C(lit.) | | density | 1.0311 (rough estimate) | | refractive index | 1.5260 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Flakes | | color | White | | Odor | Odorless | | Water Solubility | Soluble in water and methanol. | | Sensitive | Hygroscopic | | λmax | λ: 240 nm Amax: 0.04 λ: 250 nm Amax: 0.03 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 | | BRN | 3763391 | | Stability: | Hygroscopic | | InChI | 1S/C28H60N.BrH/c1-5-9-13-17-21-25-29(26-22-18-14-10-6-2,27-23-19-15-11-7-3)28-24-20-16-12-8-4;/h5-28H2,1-4H3;1H/q+1;/p-1 | | InChIKey | YQIVQBMEBZGFBY-UHFFFAOYSA-M | | SMILES | [Br-].CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC | | CAS DataBase Reference | 4368-51-8(CAS DataBase Reference) | | NIST Chemistry Reference | Tetraheptylammonium bromide(4368-51-8) | | EPA Substance Registry System | Tetraheptylammonium bromide (4368-51-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29239000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Tetraheptylammonium bromide Usage And Synthesis |
| Chemical Properties | white flakes | | Uses | Tetraheptylammonium Bromide is a catalyst in organic polymer synthesis involving redox-active crystals of polymetalate. Reagent used in the preparation of ionic liquids as novel quartz collectors. | | General Description | Tetraheptylammonium bromide is a quaternary ammonium compound (QAC) mainly used as a phase-transfer agent. | | Purification Methods | Crystallise the bromide from n-hexane, then dry it in a vacuum oven at 70o. [Goodrich et al. J Am Chem Soc 72 4412 1950, Beilstein 4 IV 736.] |
| | Tetraheptylammonium bromide Preparation Products And Raw materials |
|