| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-Fluoro-4-(tributylstannyl)pyridine Basic information |
| | 3-Fluoro-4-(tributylstannyl)pyridine Chemical Properties |
| density | 1.773 g/mL at 25 °C | | storage temp. | -20°C | | form | liquid | | InChI | 1S/C5H3FN.3C4H9.Sn/c6-5-2-1-3-7-4-5;3*1-3-4-2;/h1,3-4H;3*1,3-4H2,2H3; | | InChIKey | KKOFZNIMGWDVQS-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1ccncc1F |
| Hazard Codes | T,N | | Risk Statements | 21-25-36/38-48/23/25-50/53 | | Safety Statements | 35-36/37/39-45-60-61 | | RIDADR | UN 2788 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
| | 3-Fluoro-4-(tributylstannyl)pyridine Usage And Synthesis |
| | 3-Fluoro-4-(tributylstannyl)pyridine Preparation Products And Raw materials |
|