- imazethapyr
-
-
2026-07-14
- CAS:81385-77-5
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 20tons
|
| | 5-Ethyl-2-(4-isopropyl-4-methyl-5-oxo-1H-imidazolin-2-yl)nicotinic acid Basic information |
| Product Name: | 5-Ethyl-2-(4-isopropyl-4-methyl-5-oxo-1H-imidazolin-2-yl)nicotinic acid | | Synonyms: | 5-Ethyl-2-(4-isopropyl-4-methyl-5-oxo-1H-imidazolin-2-yl)nicotinic acid;5,6-Bis(4-methoxyphenyl)-2,3-diphenylthieno[3,2-b]furan;ImazethapyrSolution,1000mg/L,1ml;Thieno[3,2-b]furan, 5,6-bis(4-methoxyphenyl)-2,3-diphenyl-;96% imidazolyl nicotinic acid technical;IMidacolin;5-Ethyl-2-(4-isopropyl-4-methyl-5-oxo-1H-imidazolin-2-yl)nicotinicaci;IMAZETHAPYR | | CAS: | 81385-77-5 | | MF: | C32H24O3S | | MW: | 488.6 | | EINECS: | | | Product Categories: | | | Mol File: | 81385-77-5.mol |  |
| | 5-Ethyl-2-(4-isopropyl-4-methyl-5-oxo-1H-imidazolin-2-yl)nicotinic acid Chemical Properties |
| Melting point | 188-189℃ | | Boiling point | 612.9±55.0 °C(Predicted) | | density | 1.206 | | storage temp. | Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) | | pka | 2.1, 3.9(at 25℃) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C32H24O3S/c1-33-25-17-13-22(14-18-25)28-30-32(36-31(28)24-15-19-26(34-2)20-16-24)27(21-9-5-3-6-10-21)29(35-30)23-11-7-4-8-12-23/h3-20H,1-2H3 | | InChIKey | LBJMFIDRSJIPEE-UHFFFAOYSA-N | | SMILES | O1C(C2=CC=CC=C2)=C(C2=CC=CC=C2)C2SC(C3=CC=C(OC)C=C3)=C(C3=CC=C(OC)C=C3)C1=2 |
| | 5-Ethyl-2-(4-isopropyl-4-methyl-5-oxo-1H-imidazolin-2-yl)nicotinic acid Usage And Synthesis |
| Description | Imazethapyr is stable for >12 months at 25 C. Rapidly
degraded by photolysis in water under simulated sunlight;
DT50 = 3 d. Decomposes at 180 C (19). | | Uses | Imazethapyr is registered throughout the world for use on
soybeans, edible beans, alfalfa, peanut, and imidazolinoneresistant
maize, rice, and canola (19). It is applied at 70 g
ai/ha. |
| | 5-Ethyl-2-(4-isopropyl-4-methyl-5-oxo-1H-imidazolin-2-yl)nicotinic acid Preparation Products And Raw materials |
|