|
|
| | 3-[2-[(1R,4aβ)-2-Methylene-5α-(hydroxymethyl)-5,8aα-dimethyl-6α-hydroxydecalin-1α-yl]ethyl]-2,5-dihydrofuran-2-one Basic information |
| Product Name: | 3-[2-[(1R,4aβ)-2-Methylene-5α-(hydroxymethyl)-5,8aα-dimethyl-6α-hydroxydecalin-1α-yl]ethyl]-2,5-dihydrofuran-2-one | | Synonyms: | 3-[2-[(1R,4aS,5R,6R,8aS)-Decahydro-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylene-1-naphthalenyl]ethyl]-2(5H)-furanone;AD 04130-4;3-[2-[(1R,4aβ)-2-Methylene-5α-(hydroxymethyl)-5,8aα-dimethyl-6α-hydroxydecalin-1α-yl]ethyl]-2,5-dihydrofuran-2-one;3-[2-[(1R,4aβ)-Decahydro-6α-hydroxy-5α-hydroxymethyl-5,8aα-dimethyl-2-methylenenaphthalen-1α-yl]ethyl]furan-2(5H)-one;3-{2-[(1R,4aS,5R,6R,8aS)-6-Hydroxy-5-(hydroxymethyl)-5,8a-dimethy l-2-methylenedecahydro-1-naphthalenyl]ethyl}-2(5H)-furanone;2(5H)-Furanone,3-[2-[(1R,4aS,5R,6R,8aS)-decahydro-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylene-1-naphthalenyl]ethyl]-;Andrographolide Impurity 8;platelet activating factor,rat,bovine neutrophils,14 Deoxyandrographolide,Calcium Channel,inhibit,14-Deoxyandrographolide,Ca channels,uterine smooth muscle,Inhibitor,14Deoxyandrographolide,Ca2+ channels | | CAS: | 4176-97-0 | | MF: | C20H30O4 | | MW: | 334.45 | | EINECS: | 2017-001-1 | | Product Categories: | | | Mol File: | 4176-97-0.mol | ![3-[2-[(1R,4aβ)-2-Methylene-5α-(hydroxymethyl)-5,8aα-dimethyl-6α-hydroxydecalin-1α-yl]ethyl]-2,5-dihydrofuran-2-one Structure](CAS/GIF/4176-97-0.gif) |
| | 3-[2-[(1R,4aβ)-2-Methylene-5α-(hydroxymethyl)-5,8aα-dimethyl-6α-hydroxydecalin-1α-yl]ethyl]-2,5-dihydrofuran-2-one Chemical Properties |
| Melting point | 176-178℃ | | Boiling point | 509.5±50.0 °C(Predicted) | | density | 1.15 | | storage temp. | Store at -20°C | | solubility | Acetonitrile: soluble | | form | A solid | | pka | 14.89±0.70(Predicted) | | color | White to off-white | | InChI | InChI=1S/C20H30O4/c1-13-4-7-16-19(2,10-8-17(22)20(16,3)12-21)15(13)6-5-14-9-11-24-18(14)23/h9,15-17,21-22H,1,4-8,10-12H2,2-3H3/t15-,16+,17-,19+,20+/m1/s1 | | InChIKey | GVRNTWSGBWPJGS-YSDSKTICSA-N | | SMILES | O1CC=C(CC[C@H]2[C@@]3(C)[C@@]([H])([C@@](CO)(C)[C@H](O)CC3)CCC2=C)C1=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-[2-[(1R,4aβ)-2-Methylene-5α-(hydroxymethyl)-5,8aα-dimethyl-6α-hydroxydecalin-1α-yl]ethyl]-2,5-dihydrofuran-2-one Usage And Synthesis |
| Chemical Properties | White powder, soluble in methanol, ethanol, DMSO and other organic solvents, from Andrographis paniculata (Burm. f.) Nees. | | Uses | 14-Deoxyandrographolide is an Ayurvedic herb Kalmegh (Andrographis paniculata) that is used to fight against respiratory viral infections. | | in vivo | 14-Deoxyandrographolide (40 mg/kg, intraperitoneal injection, single dose) makes rat liver cells resistant to apoptosis induced by TNF-α by downregulating the formation of death-inducing signaling complex. It enhances the activity of microsomal Ca-ATPase and increases calcium ion influx into the microsomal lumen through the NO/cGMP pathway, which in turn promotes the release of TNFRSF1A[2]. | Animal Model: | Male Sprague-Dawley rats[2] | | Dosage: | 40 mg/kg; single dose | | Administration: | Intraperitoneal injection (i.p.) | | Result: | Reduced ALT elevation caused by TNF-α/ActD, reduced the number of hepatocyte apoptosis, and reduced the amount of TNF-α retained in the liver. |
| | IC 50 | Caspase 3 |
| | 3-[2-[(1R,4aβ)-2-Methylene-5α-(hydroxymethyl)-5,8aα-dimethyl-6α-hydroxydecalin-1α-yl]ethyl]-2,5-dihydrofuran-2-one Preparation Products And Raw materials |
|