2,5-Bis(trifluoromethyl)benzoic acid manufacturers
|
| | 2,5-Bis(trifluoromethyl)benzoic acid Basic information |
| Product Name: | 2,5-Bis(trifluoromethyl)benzoic acid | | Synonyms: | RARECHEM AL BO 1002;2,5-DI(TRIFLUOROMETHYL)BENZOIC ACID;2,5-BIS(TRIFLUOROMETHYL)BENZOIC ACID;2,5-BIS(TRIFLUOROMETHYL)BENZOIC ACID, 98 %;2,5-Bis(trifluoromethyl)benzoic acid 98%;Benzoic acid, 2,5-bis(trifluoromethyl)- | | CAS: | 42580-42-7 | | MF: | C9H4F6O2 | | MW: | 258.12 | | EINECS: | 625-656-0 | | Product Categories: | C9;Carbonyl Compounds;Carboxylic Acids;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Benzoic acid;Benzotrifluoride Series;Building Blocks;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks;Fluorine series | | Mol File: | 42580-42-7.mol |  |
| | 2,5-Bis(trifluoromethyl)benzoic acid Chemical Properties |
| Melting point | 78-80 °C(lit.) | | Boiling point | 248.5±40.0 °C(Predicted) | | density | 1.527±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.80±0.36(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C9H4F6O2/c10-8(11,12)4-1-2-6(9(13,14)15)5(3-4)7(16)17/h1-3H,(H,16,17) | | InChIKey | PINBPLCVZSKLTF-UHFFFAOYSA-N | | SMILES | OC(=O)c1cc(ccc1C(F)(F)F)C(F)(F)F | | CAS DataBase Reference | 42580-42-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,5-Bis(trifluoromethyl)benzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 2,5-Bis(trifluoromethyl)benzoic acid may be used in chemical synthesis. | | Definition | ChEBI: A benzoic acid carrying trifluoromethyl substituents at the 2- and 5-positions. |
| | 2,5-Bis(trifluoromethyl)benzoic acid Preparation Products And Raw materials |
|