|
|
| | 1-Hexyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide Basic information | | Uses |
| Product Name: | 1-Hexyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide | | Synonyms: | bis(trifluoromethylsulfonyl)azanide:1-hexyl-3-methylimidazol-3-ium;1-Hexyl-3-MethyliMidazoliuM Bis(trifluoroMethanesulfonyl)iMide;1-Hexyl-3-methylimidazolium bis(trifluormethylsulfonyl)imide
;HMIM BTI;HMIM TFS;1-Hexyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide for synthesis;1-Hexyl-3-methylimidazolium bis[(trifluoromethyl)sulfonyl]imide in stock Factory;1-Hexyl-3-methylimidazoliumBis(trifluoromethanesulfonyl)imide> | | CAS: | 382150-50-7 | | MF: | C12H19F6N3O4S2 | | MW: | 447.42 | | EINECS: | | | Product Categories: | | | Mol File: | 382150-50-7.mol |  |
| | 1-Hexyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide Chemical Properties |
| Melting point | -9°C(lit.) | | density | 1.37 g/cm3 | | refractive index | 1.4300 to 1.4340 | | Fp | -9℃ | | storage temp. | Store below +30°C. | | form | clear liquid | | color | Colorless to Light orange to Yellow | | PH | 6 (H2O, 20℃) | | InChI | InChI=1S/C10H19N2.C2F6NO4S2/c1-3-4-5-6-7-12-9-8-11(2)10-12;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h8-10H,3-7H2,1-2H3;/q+1;-1 | | InChIKey | RCNFOZUBFOFJKZ-UHFFFAOYSA-N | | SMILES | S(=O)(=O)(C(F)(F)F)[N-]S(=O)(=O)C(F)(F)F.[N+]1(C)C=CN(CCCCCC)C=1 | | ECW | 5.3 V |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2935 90 90 | | Storage Class | 10 - Combustible liquids |
| | 1-Hexyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide Usage And Synthesis |
| Uses | Bis(trifluoromethylsulfonyl)azanide;1-hexyl-3-methylimidazol-3-ium is a useful research chemical. | | Conductivity | 2.27 mS/cm (30 °C) | | Uses | - Electrochemical behavior and determination of rutin on modified carbon paste electrodes.: This research investigates the electrochemical properties of rutin using modified carbon paste electrodes incorporating 1-Hexyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide, an ionic liquid. The study highlights the ionic liquid′s role in enhancing the electrode′s sensitivity and stability, making it a promising material for electrochemical sensing applications (Macikova et al., 2012).
| | General Description | 1-Hexyl-3-methylimidazolium bis(trifluormethylsulfonyl)imide is a 1-alkyl-3-methylimidazolium based ionic liquid. The solubility of gases such as oxygen and methane in HMIM TFS can be improved in the presence of carbon dioxide. |
| | 1-Hexyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide Preparation Products And Raw materials |
|