| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
|
| | 4-(Diphenylphosphino)benzoic acid Basic information |
| | 4-(Diphenylphosphino)benzoic acid Chemical Properties |
| Melting point | 157-160 °C (lit.) | | Boiling point | 448.0±28.0 °C(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 4.01±0.10(Predicted) | | form | Crystalline Powder | | color | White to yellow | | InChI | 1S/C19H15O2P/c20-19(21)15-11-13-18(14-12-15)22(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14H,(H,20,21) | | InChIKey | GXMHDTPYKRTARV-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(cc1)P(c2ccccc2)c3ccccc3 | | CAS DataBase Reference | 2129-31-9 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-(Diphenylphosphino)benzoic acid Usage And Synthesis |
| Uses | 4-(Diphenylphosphino)benzoic acid can be used as a ligand in the synthesis of:- Organostannoxane-supported palladium nanoparticles. The resulting catalysts show high activity and selectivity in Suzuki-coupling reactions.
- Polymetallic ruthenium-zinc complex catalyst for the hydrogenation of levulinic acid to γ-valerolactone.
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | 4-(Diphenylphosphino)benzoic acid Preparation Products And Raw materials |
|