| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | Diphenyl(p-tolyl)phosphine Basic information |
| | Diphenyl(p-tolyl)phosphine Chemical Properties |
| Melting point | 66-68 °C (lit.) | | Boiling point | 250 °C(Press: 14 Torr) | | storage temp. | 2-8°C | | form | crystal | | color | white | | BRN | 646709 | | InChI | InChI=1S/C19H17P/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15H,1H3 | | InChIKey | QJIMTLTYXBDJFC-UHFFFAOYSA-N | | SMILES | P(C1=CC=C(C)C=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | | CAS DataBase Reference | 1031-93-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-38-37-36 | | Safety Statements | 26-37/39-39-37 | | WGK Germany | 3 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Diphenyl(p-tolyl)phosphine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Reactant for:
- Three-component cyclization
- Probing coordination ability via a palladium pincer complex
- Chelation-assisted hydroacylation of olefins with primary alcohols
Reactant for synthesis of:
- Trinuclear ruthenium carbonyl triarylphosphine cluster complexes
- Leishmanicidal leads targeting mitochondria through inhibition of the respiratory complex
- InP nanofibers / metal phosphide nanostructures
- Peroxyl radical cations via pulse radiolysis one-electron oxidations
| | Synthesis Reference(s) | The Journal of Organic Chemistry, 52, p. 748, 1987 DOI: 10.1021/jo00381a008 | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
| | Diphenyl(p-tolyl)phosphine Preparation Products And Raw materials |
|