|
|
| | (3aR,4S,7R,7aS) 4,7-Methano-1H-isoindole-1,3(2H)-dione Basic information |
| Product Name: | (3aR,4S,7R,7aS) 4,7-Methano-1H-isoindole-1,3(2H)-dione | | Synonyms: | 4,7-Methano-1H-isoindole-1,3(2H)-dione, hexahydro-, (3aR,4S,7R,7aS)-rel-;(3aR,4S,7R,7aS)-rel-Hexahydro-4,7-Methano-1H-isoindole-;exo-2,3-NorbornanedicarboxiMide;(3aR,7aS)-rel-hexahydro-4,7-Methano-1H-isoindole-1,3(2H)-dione (relative stereo structure));Bicyclo[2,2,1]heptane-2,3-di-exo-carboximide;Lurasidone INT 1;Bicyclo[2.2.1]hep-tane-2,3-exo- dicarboximide;hexahydro-1H-4,7-methanoisoindole-1,3(2H)-dione | | CAS: | 14805-29-9 | | MF: | C9H11NO2 | | MW: | 165.19 | | EINECS: | 689-268-3 | | Product Categories: | | | Mol File: | 14805-29-9.mol |  |
| | (3aR,4S,7R,7aS) 4,7-Methano-1H-isoindole-1,3(2H)-dione Chemical Properties |
| Melting point | 173-176℃ | | Boiling point | 355℃ | | density | 1.285 | | Fp | 171℃ | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 11.85±0.20(Predicted) | | color | White to Light Brown | | InChI | InChI=1/C9H11NO2/c11-8-6-4-1-2-5(3-4)7(6)9(12)10-8/h4-7H,1-3H2,(H,10,11,12)/t4-,5+,6+,7- | | InChIKey | RIVOBMOBWMOLDJ-RNGGSSJXNA-N | | SMILES | C1(=O)[C@]2([H])[C@@]([H])([C@]3([H])C[C@@]2([H])CC3)C(=O)N1 |&1:2,4,6,9,r| |
| | (3aR,4S,7R,7aS) 4,7-Methano-1H-isoindole-1,3(2H)-dione Usage And Synthesis |
| Chemical Properties | (3aR,4S,7R,7aS) 4,7-Methano-1H-isoindole-1,3(2H)-dione, white to almost white powder to crystalline in appearance, melting point 152°C, stored at 2-8°C. | | Uses | (3AR,4S,7R,7AS) 4,7-methylene-1H-isoindole-1,3(2H)-dione can be used as an intermediate for organic synthesis and pharmaceutical research and development, suitable for laboratory organic synthesis It can be used as the raw material for the synthetic raw material medicine lurasidone in the synthesis process of chemical medicine. | | Uses | exo-2,3-Norbornanedicarboximide is a Lurasidone (L474920) intermediate. | | Synthesis | General procedure for the synthesis of (3aR,4S,7R,7aS)-rel-(3aR,4S,7R,7aS)-rel-hexahydro-1H-4,7-methanoisoindoline-1,3(2H)-dione from rel-(3aR,4S,7R,7aS)-3a,4,7,7a-tetrahydro-1H-4,7-methanoiisoindoline-1,3(2H)-dione: In an autoclave, 3.8 kg palladium carbon (10% w/w, 50% H2O) and the raw material rel-(3aR,4S,7R,7aS)-3a,4,7,7a-tetrahydro-1H-4,7-methylene-bridged isoindoline-1,3(2H)-dione (68.8 kg, 421.3 mol) were suspended in methanol (1000 L). Subsequently, the autoclave was sealed and the air in the autoclave was replaced with nitrogen, and then hydrogen was introduced to a pressure of 8 atm. The reaction process was monitored by hydrogen consumption and gas chromatography (GC). Upon completion of the reaction, the reaction solution was concentrated to a smaller volume and water (200 L) was slowly added over a period of about 30 min. The resulting suspension was cooled and a white solid was separated by centrifugation and washed with 50 L of water to give the final product (3aR,4S,7R,7aS)-rel-hexahydro-1H-4,7-bridged methylidene isoindole-1,3(2H)-dione (dry weight 63.6 kg, yield 91.4%, GC purity 99.99%). | | References | [1] Patent: WO2015/56205, 2015, A1. Location in patent: Page/Page column 13; 14 |
| | (3aR,4S,7R,7aS) 4,7-Methano-1H-isoindole-1,3(2H)-dione Preparation Products And Raw materials |
|