|
|
| | tert-Butyl 2-azaspiro[3.3]heptan-6-ylcarbamate Basic information |
| Product Name: | tert-Butyl 2-azaspiro[3.3]heptan-6-ylcarbamate | | Synonyms: | N-(6-azaspiro[3.3]heptan-2-yl)carbamic acid tert-butyl ester;Carbamic acid, N-?2-?azaspiro[3.3]?hept-?6-?yl-?, 1,?1-?dimethylethyl ester;tert-Butyl 2-azaspiro[3.3]hept-6-ylcarbamate 97%;(2-Aza-spiro[3.3]hept-6-yl)-carbamic acid tert-butyl ester;tert-butyl 2-azaspiro[3.3...;tert-butyl 2-azaspiro[3.3]hept-6-ylcarbaMate;tert-butyl N-{2-azaspiro[3.3]heptan-6-yl}carbaMate;tert-butyl 2-azaspiro[3.3]heptan-6-ylcarbaMate | | CAS: | 1118786-85-8 | | MF: | C11H20N2O2 | | MW: | 212.29 | | EINECS: | | | Product Categories: | | | Mol File: | 1118786-85-8.mol | ![tert-Butyl 2-azaspiro[3.3]heptan-6-ylcarbamate Structure](CAS2/GIF/1118786-85-8.gif) |
| | tert-Butyl 2-azaspiro[3.3]heptan-6-ylcarbamate Chemical Properties |
| Boiling point | 329.0±42.0 °C(Predicted) | | density | 1.09 | | storage temp. | 2-8°C(protect from light) | | pka | 12.38±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H20N2O2/c1-10(2,3)15-9(14)13-8-4-11(5-8)6-12-7-11/h8,12H,4-7H2,1-3H3,(H,13,14) | | InChIKey | CBYPCXLWNJUVLF-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1CC2(CNC2)C1 |
| | tert-Butyl 2-azaspiro[3.3]heptan-6-ylcarbamate Usage And Synthesis |
| Uses | Tert-Butyl 2-azaspiro[3.3]heptan-6-ylcarbamate is an important pharmaceutical intermediate and organic synthesis building block, mainly used in the field of medicinal chemistry to synthesize bioactive molecules containing spirocyclic structures. Its unique spiro[3.3]heptane skeleton can provide novel three-dimensional spatial configurations. |
| | tert-Butyl 2-azaspiro[3.3]heptan-6-ylcarbamate Preparation Products And Raw materials |
|