- NH2-PEG6-CH2CH2COOH
-
-
2026-01-28
- CAS:905954-28-1
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 300kg
|
| | alpha-aMine-oMega-propionic acid hexaethylene glycol Basic information |
| Product Name: | alpha-aMine-oMega-propionic acid hexaethylene glycol | | Synonyms: | alpha-aMine-oMega-propionic acid hexaethylene glycol;α-aMine-ω-propionic acid hexaethylene glycol;1-Amino-3,6,9,12,15,18-hexaoxaheneicosan-21-oic acid;Amino-PEG6-acid;amino-dPEG 6-acid;Amino-PEG6-propionic acid;AMINE-PEG6-COOH;Amino-dPEG(R)6-acid | | CAS: | 905954-28-1 | | MF: | C15H31NO8 | | MW: | 353.41 | | EINECS: | | | Product Categories: | peg | | Mol File: | 905954-28-1.mol |  |
| | alpha-aMine-oMega-propionic acid hexaethylene glycol Chemical Properties |
| Boiling point | 481.0±45.0 °C(Predicted) | | density | 1.130±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | solid or viscous liquid | | pka | 4.28±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C15H31NO8/c16-2-4-20-6-8-22-10-12-24-14-13-23-11-9-21-7-5-19-3-1-15(17)18/h1-14,16H2,(H,17,18) | | InChIKey | PVRGRRPCHFTMMD-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOCCOCCOCCOCCOCCOCCN |
| WGK Germany | WGK 3 | | HS Code | 2942000090 | | Storage Class | 11 - Combustible Solids |
| | alpha-aMine-oMega-propionic acid hexaethylene glycol Usage And Synthesis |
| Description | Amino-PEG6-acid is a PEG reagent composing one amine (NH2) and one terminal carboxylic acid group (CO2). The hydrophilic PEG spacer increases solubility in aqueous media. The amino group is reactive with activated NHS esters to form a stable amide bond. | | Uses | NH2-PEG6-CH2CH2COOH is a cleavable 6 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). NH2-PEG6-CH2CH2COOH is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | reaction suitability | reagent type: cross-linking reagent
reactivity: carboxyl reactive | | IC 50 | Cleavable Linker; PEGs | | References | [1] Jaume Pons, et al. Engineered polypeptide conjugates and methods for making thereof using transglutaminase. US20130230543A1. |
| | alpha-aMine-oMega-propionic acid hexaethylene glycol Preparation Products And Raw materials |
|