|
|
| | 3-(9H-Carbazol-9-yl)phenylboronic acid Basic information |
| Product Name: | 3-(9H-Carbazol-9-yl)phenylboronic acid | | Synonyms: | 3-(9H-Carbazol-9-yl)phenylboronic acid;3-(9H-carbazole-9-yl)phenylboronic acid;3-(9H-Carbazol-9-yl)phenylboromic acid;Boronic acid, [3-(9H-carbazol-9-yl)phenyl]-;3-(9-Carbazolyl)benzeneboronic acid, 98%;3-(9H-carbazol-9-yl)phenylboronic acid
(3CPBA);Boronic acid,B-[3-(9H-carbazol-9-yl)phenyl]-;3-(9H-Carbazol-9-yl)phenylboronic Acid (contains varying amounts of Anhydride) | | CAS: | 864377-33-3 | | MF: | C18H14BNO2 | | MW: | 287.12 | | EINECS: | | | Product Categories: | OLED materials,pharm chemical,electronic;OLED | | Mol File: | 864377-33-3.mol |  |
| | 3-(9H-Carbazol-9-yl)phenylboronic acid Chemical Properties |
| Boiling point | 472.6±51.0 °C(Predicted) | | density | 1.20 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Powder | | pka | 8.30±0.10(Predicted) | | color | Off-white | | InChI | InChI=1S/C18H14BNO2/c21-19(22)13-6-5-7-14(12-13)20-17-10-3-1-8-15(17)16-9-2-4-11-18(16)20/h1-12,21-22H | | InChIKey | IDQUIFLAFFZYEX-UHFFFAOYSA-N | | SMILES | B(C1=CC=CC(N2C3=C(C=CC=C3)C3=C2C=CC=C3)=C1)(O)O |
| | 3-(9H-Carbazol-9-yl)phenylboronic acid Usage And Synthesis |
| Chemical Properties | off-white solid | | Uses | suzuki reaction | | Synthesis | General procedure for the synthesis of 3-(9H-carbazol-9-yl)phenylboronic acid from 9-(3-bromophenyl)-9H-carbazole and trimethyl borate: (2) Dissolve 4.00 g of 9-(3-bromophenyl)-9H-carbazole in dry 50 mL of THF, and cool to -78 °C. 6mL (2.4M) of n-butyllithium solution was slowly added and reacted for 1 hour. Subsequently, 1.8 mL of trimethyl borate was added and the reaction continued for 2 hours. The reaction mixture was warmed to room temperature and stirred overnight. After cooling to 0°C, 40 mL of 2.0 M HCl was added for hydrolysis. The reaction mixture was extracted with dichloromethane and the solvent was evaporated to give 2.96 g of 3-(9H-carbazol-9-yl)phenylboronic acid in 83% yield. | | References | [1] Patent: CN103588770, 2016, B. Location in patent: Paragraph 0047
[2] Patent: CN107686484, 2018, A. Location in patent: Paragraph 0129-0132
[3] Patent: WO2013/12298, 2013, A1. Location in patent: Paragraph 103-104 |
| | 3-(9H-Carbazol-9-yl)phenylboronic acid Preparation Products And Raw materials |
|