- Cbz-L-Ala-Ala-OH
-
-
2026-09-30
- CAS:16012-70-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- Z-ALA-ALA-OH
-
-
2026-09-20
- CAS:16012-70-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 2000
- Cbz-Ala-Ala-OH
-
- $1.00
-
2020-01-06
- CAS:16012-70-7
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
|
| | Z-Ala-Ala-OH Basic information |
| Product Name: | Z-Ala-Ala-OH | | Synonyms: | N-CARBOBENZOXY-L-ALANYL-L-ALANINE;Z-L-ALANYL-L-ALANINE;N-cbz-ala-ala;L-alanyl(benzyloxycarbonyl)-L-alanine;N-ALPHA-CBZ-ALANYL-ALANINE;Z-Ala-Ala-OH≥ 99% (HPLC);Cbz-L-Ala-L-Ala-OH;N-[N-[(Phenylmethoxy)carbonyl]-L-alanyl]-L-alanine | | CAS: | 16012-70-7 | | MF: | C14H18N2O5 | | MW: | 294.3 | | EINECS: | 240-149-0 | | Product Categories: | | | Mol File: | 16012-70-7.mol |  |
| | Z-Ala-Ala-OH Chemical Properties |
| Melting point | 136-140 °C | | Boiling point | 573.0±45.0 °C(Predicted) | | density | 1.252±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.51±0.10(Predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | -23.3° (C=1.00 g/100ml ETHANOL) | | InChI | 1S/C14H18N2O5/c1-9(12(17)15-10(2)13(18)19)16-14(20)21-8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H,15,17)(H,16,20)(H,18,19)/t9-,10-/m0/s1 | | InChIKey | JBGCVTHXXTVYIP-UWVGGRQHSA-N | | SMILES | O=C(N[C@@H](C)C(N[C@@H](C)C(O)=O)=O)OCC1=CC=CC=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Z-Ala-Ala-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Z-Ala-Ala-OH is a non-polar amino acid that can be used in enzymatic peptide synthesis[1]. | | References | [1] Sayed Mohiuddin Abdus Salam, et al. Protease-catalyzed dipeptide synthesis from N-protected amino acid carbamoylmethyl esters and free amino acids in frozen aqueous solutions. Enzyme and Microbial Technology. 2008, 43, 7. |
| | Z-Ala-Ala-OH Preparation Products And Raw materials |
|