| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | ALA-ALA-ALA-ALA-ALA Basic information |
| Product Name: | ALA-ALA-ALA-ALA-ALA | | Synonyms: | L-ALA-ALA-ALA-ALA-ALA;H-ALA-ALA-ALA-ALA-ALA-OH;ALA-ALA-ALA-ALA-ALA;PENTA-ALA;PENTA-L-ALANINE;D-Penta-L-Alanine;L-Alanine, L-alanyl-L-alanyl-L-alanyl-L-alanyl-;AAAAA (peptide) | | CAS: | 10183-34-3 | | MF: | C15H27N5O6 | | MW: | 373.4 | | EINECS: | | | Product Categories: | | | Mol File: | 10183-34-3.mol |  |
| | ALA-ALA-ALA-ALA-ALA Chemical Properties |
| Melting point | >250oC (dec.) | | Boiling point | 822.3±65.0 °C(Predicted) | | density | 1.244±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | solubility | Aqueous Acid (Slightly), Water (Slightly) | | form | Solid | | pka | 3.43±0.10(Predicted) | | color | White to Off-White | | Sequence | Ala-Ala-Ala-Ala-Ala | | InChI | 1S/C15H27N5O6/c1-6(16)11(21)17-7(2)12(22)18-8(3)13(23)19-9(4)14(24)20-10(5)15(25)26/h6-10H,16H2,1-5H3,(H,17,21)(H,18,22)(H,19,23)(H,20,24)(H,25,26) | | InChIKey | XXAUOPDVAKGRPR-UHFFFAOYSA-N | | SMILES | CC(N)C(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | ALA-ALA-ALA-ALA-ALA Usage And Synthesis |
| Uses | Penta-alanine (Penta-L-alanine) is a petide. Penta-alanine can be used for neurological disease research[1][2]. | | Biochem/physiol Actions | L-Alanine has wide range of applications as food additive and as a component in infusion solutions. It is also used as a precursor for chemical and pharmaceutical products. In a penta-alanine system, resampling helps to increase the efficacy of a “fast-switch” equilibrium sampling protocol. | | References | [1] Niu L, et al. Transformation of β-sheet structures of the amyloid peptide induced by molecular modulators. Chem Commun (Camb). 2014 Aug 18;50(64):8923-6. DOI:10.1039/c4cc02748e
[2] Mu Y, et al. Energy landscape of a small peptide revealed by dihedral angle principal component analysis. Proteins. 2005 Jan 1;58(1):45-52. DOI:10.1002/prot.20310 |
| | ALA-ALA-ALA-ALA-ALA Preparation Products And Raw materials |
|