| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
1,3,5-tri(thiophen-2-yl)benzene manufacturers
|
| | 1,3,5-tri(thiophen-2-yl)benzene Basic information |
| Product Name: | 1,3,5-tri(thiophen-2-yl)benzene | | Synonyms: | 1,3,5-tri(thiophen-2-yl)benzene;1,3,5-Tri(2-thienyl)benzene;1,3,5-Tris(2-thienyl)benzene;Thiophene, 2,2',2''-(1,3,5-benzenetriyl)tris-;2,2',2''-(1,3,5-Benzenetriyl)tris[thiophene;2-[3,5-bis(2-thienyl)phenyl]thiophene;1,3,5-Tri(thiophen-2-yl)benzene - [T94289] | | CAS: | 15509-95-2 | | MF: | C18H12S3 | | MW: | 324.48 | | EINECS: | 695-506-7 | | Product Categories: | | | Mol File: | 15509-95-2.mol |  |
| | 1,3,5-tri(thiophen-2-yl)benzene Chemical Properties |
| Melting point | 157.0 to 161.0 °C | | Boiling point | 298°C/10mmHg(lit.) | | density | 1.278±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Light yellow | | InChI | 1S/C18H12S3/c1-4-16(19-7-1)13-10-14(17-5-2-8-20-17)12-15(11-13)18-6-3-9-21-18/h1-12H | | InChIKey | UBHPRZXDFVCNHZ-UHFFFAOYSA-N | | SMILES | c1csc(c1)-c2cc(cc(c2)-c3cccs3)-c4cccs4 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2934.99.4400 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1,3,5-tri(thiophen-2-yl)benzene Usage And Synthesis |
| Uses | 1,3,5-Tris(2-thienyl)benzene is a trifunctionalized monomer that can be used in the synthesis of conjugated C3-symmetric poly(arylbenzene) polymers. These polymeric materials can further be used in organic photovoltaic devices as well as organic field effect transistors (OFETs) and organic light emitting diodes (OLED) systems. | | General Description | 1,3,5-Tris(2-thienyl)benzene is a 1,3,5 tris substituted benzene that has a three dimensional structure which facilitates the preparation of conjugating polymers. It is a branched conductive monomer with electronically attached nodes that provide a suitable support to increase the conductivity of the synthesized polymers. |
| | 1,3,5-tri(thiophen-2-yl)benzene Preparation Products And Raw materials |
| Raw materials | Zinc, chloro-2-thienyl--->2-Thienylmagnesium bromide solution-->1,3,5-Triiodobenzene-->1,3-Di-2-thienyl-2-propen-1-one-->1,3,5-Phenyltriboronic acid, pinacol ester-->2-(Tributylstannyl)thiophene-->3-Ethynylthiophene-->2-Ethynylthiophene-->Thiophene-2-boronic acid pinacol ester-->2-Thiopheneboronic acid-->2-Acetylthiophene-->Dimethyl sulfoxide-->1,3,5-Tribromobenzene | | Preparation Products | Thiophene, 2-(2-nitroethyl)- |
|