11-cis Vaccenyl Acetate manufacturers
|
| | 11-cis Vaccenyl Acetate Basic information |
| Product Name: | 11-cis Vaccenyl Acetate | | Synonyms: | (Z)-octadec-11-enyl acetate;11-cis Vaccenyl Acetate Exclusive;QSZKEDWVAOAFQY-HJWRWDBZSA-N;11-cis Vaccenyl Acetate;11-Octadecen-1-ol, 1-acetate, (11Z)-;11(Z)-Vaccenyl acetate;Endogenous Metabolite,inhibit,Inhibitor,11cisVaccenyl acetate,11 cis Vaccenyl acetate;11 VACCENYL ACETATE | | CAS: | 6186-98-7 | | MF: | C20H38O2 | | MW: | 310.52 | | EINECS: | | | Product Categories: | | | Mol File: | 6186-98-7.mol |  |
| | 11-cis Vaccenyl Acetate Chemical Properties |
| Boiling point | 379.515±11.00 °C(Press: 760.00 Torr)(predicted) | | density | 0.873±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at -20°C | | solubility | DMF: 25 mg/ml; DMSO: 20 mg/ml; Ethanol: 30 mg/ml; PBS (pH 7.2): 2.5 mg/ml | | form | Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C20H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h8-9H,3-7,10-19H2,1-2H3/b9-8- | | InChIKey | QSZKEDWVAOAFQY-HJWRWDBZSA-N | | SMILES | C(OC(=O)C)CCCCCCCCC/C=C\CCCCCC |
| | 11-cis Vaccenyl Acetate Usage And Synthesis |
| Description | The mating and social behaviors of insects are largely orchestrated by a suite of volatile hydrocarbon pheromones. 11-cis Vaccenyl acetate is the male-specific mating pheromone of the fruit fly D. melanogaster. It acts selectively through the Or67d odorant receptor to control mating behavior in both male and female fruit flies. | | Uses | (Z)-11-Octadecenyl Acetate is a Drosophila sex pheromone. | | Definition | ChEBI: (Z)-octadec-11-enyl acetate is an acetate ester. It is functionally related to a (Z)-octadec-11-enol. | | References | [1] AMINA KURTOVIC Barry J D Alexandre Widmer. A single class of olfactory neurons mediates behavioural responses to a Drosophila sex pheromone[J]. Nature, 2007, 446 7135: 542-546. DOI: 10.1038/nature05672 |
| | 11-cis Vaccenyl Acetate Preparation Products And Raw materials |
|