|
|
| | Tris(dipivaloylmethanato)lanthanum Basic information |
| Product Name: | Tris(dipivaloylmethanato)lanthanum | | Synonyms: | Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)lanthanum (III), (La(TMHD)3);Lanthanum tris(2,2,6,6-tetramethyl-3,5-heptanedionate);lanthanum(iii) tris(2,2,6,6-tetramethyl-3,5-heptanedionate;Tris-(2,2,6,6-tetramethyl-3,5-heptanedionato)lanthan(III);TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)LANTHANUM(III) (99.9% LA) (REO);[Lanthanum(III) thd];lanthanum(III) tris(tetramethylheptanedionate);La(tmhd)3, Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)lanthanum | | CAS: | 14319-13-2 | | MF: | C33H57LaO6 | | MW: | 688.72 | | EINECS: | | | Product Categories: | metal beta-diketonate complexes;Other Metal | | Mol File: | 14319-13-2.mol |  |
| | Tris(dipivaloylmethanato)lanthanum Chemical Properties |
| Melting point | 128-131 °C | | Boiling point | 370°C | | Fp | 370°C | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | Powder | | color | white | | Sensitive | Hygroscopic | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/3C11H20O2.La/c3*1-10(2,3)8(12)7-9(13)11(4,5)6;/h3*7,12H,1-6H3;/q;;;+3/p-3/b3*8-7-; | | InChIKey | IXHLTRHDDMSNAP-LWTKGLMZSA-K | | SMILES | CC(C)(C)C(=O)\C=C(/O[Yb](O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)C(C)(C)C |
| Hazard Codes | T | | Risk Statements | 62-61-36/37/38-33-20/22 | | Safety Statements | 53-45 | | WGK Germany | 3 | | TSCA | No | | HS Code | 2846901020 | | Storage Class | 11 - Combustible Solids |
| | Tris(dipivaloylmethanato)lanthanum Usage And Synthesis |
| | Tris(dipivaloylmethanato)lanthanum Preparation Products And Raw materials |
|