|
|
| | ClotriMazole IMpurity A Basic information |
| Product Name: | ClotriMazole IMpurity A | | Synonyms: | 1-(p-Chloro-α,α-diphenylbenzyl)iMidazole;1-[(4-Chlorophenyl)diphenylMethyl]-1H-iMidazole;1-[(p-Chlorophenyl)diphenylMethyl]iMidazole;CDD 3532;para-ClotriMazole IsoMer;ClotriMazole IMpurity B;Clotrimazole-001;Clotrimazole EP Impurity B | | CAS: | 23593-71-7 | | MF: | C22H17ClN2 | | MW: | 344.84 | | EINECS: | | | Product Categories: | | | Mol File: | 23593-71-7.mol |  |
| | ClotriMazole IMpurity A Chemical Properties |
| Melting point | 138-140°C | | Boiling point | 475.9±40.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | pka | 6.28±0.30(Predicted) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical | | InChI | 1S/C22H17ClN2/c23-21-13-11-20(12-14-21)22(25-16-15-24-17-25,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-17H | | InChIKey | BLNLHAFFGFCSRK-UHFFFAOYSA-N | | SMILES | Clc1ccc(cc1)C([n]4cncc4)(c3ccccc3)c2ccccc2 |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | ClotriMazole IMpurity A Usage And Synthesis |
| Uses | para-Clotrimazole Isomer is a positional isomer of the antifungal agent (C587400). It showed agonistic activity on the pregnane X receptor and regulated the levels of apoA1 and HDL-cholesterol in rode
nts. | | Uses | para-Clotrimazole Isomer (Clotrimazole EP Impurity B) is a positional isomer of the antifungal agent (C587400). It showed agonistic activity on the pregnane X receptor and regulated the levels of apoA1 and HDL-cholesterol in rodents. |
| | ClotriMazole IMpurity A Preparation Products And Raw materials |
|