|
|
| | CNS 7056 Basic information |
| Product Name: | CNS 7056 | | Synonyms: | CNS 7056;CS-638;Remimazolan;CNS-7056;CNS7056;CNS 7056;methyl 3-[(4S)-8-bromo-1-methyl-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepin-4-yl]propanoate CNS-7056 Remimazolam;Remimazolam Tosylate;Methyl 3-[(4S)-8-bromo-1-methyl-6-(2-pyridyl)-4H-imidazo[1,2-a][1,4]benzodiazepin-4-yl]propanoate;4H-Imidazo[1,2-a][1,4]benzodiazepine-4-propanoic acid, 8-bromo-1-methyl-6-(2-pyridinyl)-, methyl ester, (4S)- | | CAS: | 308242-62-8 | | MF: | C21H19BrN4O2 | | MW: | 439.31 | | EINECS: | | | Product Categories: | API | | Mol File: | 308242-62-8.mol |  |
| | CNS 7056 Chemical Properties |
| Boiling point | 583.5±60.0 °C(Predicted) | | density | 1.48±0.1 g/cm3(Predicted) | | storage temp. | -10 to -25°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 5.58±0.60(Predicted) | | form | Solid | | color | Off-White to Pale Yellow | | InChI | 1S/C21H19BrN4O2/c1-13-12-24-21-17(7-9-19(27)28-2)25-20(16-5-3-4-10-23-16)15-11-14(22)6-8-18(15)26(13)21/h3-6,8,10-12,17H,7,9H2,1-2H3/t17-/m0/s1 | | InChIKey | CYHWMBVXXDIZNZ-KRWDZBQOSA-N | | SMILES | CC1=CN=C2[C@H](CCC(OC)=O)N=C(C3=CC=CC=N3)C4=CC(Br)=CC=C4N12 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | STOT SE 3 |
| | CNS 7056 Usage And Synthesis |
| Uses | Vibegron is a potent and selective β3 Adrenergic receptor agonist for the treatment of overactive bladder. | | Biological Activity | Remimazolam (CNS 7056) is a benzodiazepine derivative with positive allosteric modulator (PAM) activity toward γ-aminobutyric acid type A (GABAA) receptor (pKi = 7.53/7.50/7.56 against 2.5 nM flunitrazepam for binding human/rat/yucatan micropig brain homogenates; pEC50/Emax = 6.44/375% (α1β2γ2), 6.18/186% (α2β2γ2), 6.04/210% (α3β2γ2), 5.86/289% (α5β2γ2s) by whole cell patch clamp using cells expressing respective r at αβγ complex). Intravenous injection (25 mg/kg rats, 15-30 mg/kg mice) causes fast onset and short duration of sedative action with rapid recovery when compared with midazolam. |
| | CNS 7056 Preparation Products And Raw materials |
|