|
|
| | 2-[3-(AMinocarbonyl)-4-(2-Methylpropoxy)phenyl]-4-Methyl-5-thiazolecarboxylic Acid Basic information |
| | 2-[3-(AMinocarbonyl)-4-(2-Methylpropoxy)phenyl]-4-Methyl-5-thiazolecarboxylic Acid Chemical Properties |
| Melting point | 225-228°C | | Boiling point | 538.9±60.0 °C(Predicted) | | density | 1.291±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 1.22±0.37(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C16H18N2O4S/c1-8(2)7-22-12-5-4-10(6-11(12)14(17)19)15-18-9(3)13(23-15)16(20)21/h4-6,8H,7H2,1-3H3,(H2,17,19)(H,20,21) | | InChIKey | ITMGNZBRUWAGOZ-UHFFFAOYSA-N | | SMILES | S1C(C(O)=O)=C(C)N=C1C1=CC=C(OCC(C)C)C(C(N)=O)=C1 |
| | 2-[3-(AMinocarbonyl)-4-(2-Methylpropoxy)phenyl]-4-Methyl-5-thiazolecarboxylic Acid Usage And Synthesis |
| Uses | 2-[3-(Aminocarbonyl)-4-(2-methylpropoxy)phenyl]-4-methyl-5-thiazolecarboxylic acid is an impurity of Febuxostat (F229000), an xanthine oxidase/xanthine dehydrogenase inhibitor used for the treatment of hyperuricemia and chronic gout. |
| | 2-[3-(AMinocarbonyl)-4-(2-Methylpropoxy)phenyl]-4-Methyl-5-thiazolecarboxylic Acid Preparation Products And Raw materials |
|