|
|
| | 8-(4-Chlorobutyl)-8-azaspiro[4.5]decane-7,9-dione Basic information |
| | 8-(4-Chlorobutyl)-8-azaspiro[4.5]decane-7,9-dione Chemical Properties |
| Boiling point | 429.4±28.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Oil | | pka | -1.48±0.20(Predicted) | | color | Colourless | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C13H20ClNO2/c14-7-3-4-8-15-11(16)9-13(10-12(15)17)5-1-2-6-13/h1-10H2 | | InChIKey | BCNBRBQCDHLCBD-UHFFFAOYSA-N | | SMILES | ClCCCCN1C(=O)CC2(CCCC2)CC1=O |
| WGK Germany | WGK 3 | | HS Code | 2933599550 | | Storage Class | 10 - Combustible liquids |
| | 8-(4-Chlorobutyl)-8-azaspiro[4.5]decane-7,9-dione Usage And Synthesis |
| Uses | 8-(4-Chlorobutyl)-8-azaspiro[4.5]decane-7,9-dione is an impurity of Buspirone (B689850), an non-benzodiazepine anxiolytic; 5-hydroxytryptamine (5-HT1) receptor agonist. | | Uses | 8-(4-Chlorobutyl)-8-azaspiro[4.5]decane-7,9-dione (Buspirone EP Impurity L) is an impurity of Buspirone (B689850), an non-benzodiazepine anxiolytic; 5-hydroxytryptamine (5-HT1) receptor agonist. |
| | 8-(4-Chlorobutyl)-8-azaspiro[4.5]decane-7,9-dione Preparation Products And Raw materials |
|