4,6-dichloro-5-(4-chlorophenyl)-pyriMidine manufacturers
|
| | 4,6-dichloro-5-(4-chlorophenyl)-pyriMidine Basic information |
| | 4,6-dichloro-5-(4-chlorophenyl)-pyriMidine Chemical Properties |
| Boiling point | 348.9±42.0 °C(Predicted) | | density | 1.466±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | -4.92±0.26(Predicted) | | InChI | 1S/C10H5Cl3N2/c11-7-3-1-6(2-4-7)8-9(12)14-5-15-10(8)13/h1-5H | | InChIKey | KIYDKTUDEIWLNO-UHFFFAOYSA-N | | SMILES | ClC1=CC=C(C(C(Cl)=NC=N2)=C2Cl)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 4,6-dichloro-5-(4-chlorophenyl)-pyriMidine Usage And Synthesis |
| | 4,6-dichloro-5-(4-chlorophenyl)-pyriMidine Preparation Products And Raw materials |
|