|
|
| | 3,5-DIIODOSALICYLALDEHYDE Basic information |
| Product Name: | 3,5-DIIODOSALICYLALDEHYDE | | Synonyms: | 3,5-DIIODOSALICYLALDEHYDE;3,5-DIIODO-2-HYDROXYBENZALDEHYDE;AKOS BBS-00003265;2-HYDROXY-3,5-DIIODOBENZALDEHYDE;Benzaldehyde, 2-hydroxy-3,5-diiodo-;3,5-Diiodo-2-hydroxybenzaldehyde~2-Hydroxy-3,5-diiodobenzaldehyde;3,5-Diodosolicylaldehyde;3,5-Diiodo-4-Hydroxybenzaldhyd | | CAS: | 2631-77-8 | | MF: | C7H4I2O2 | | MW: | 373.91 | | EINECS: | 220-117-2 | | Product Categories: | Aromatic Aldehydes & Derivatives (substituted);Aldehydes;C7;Carbonyl Compounds | | Mol File: | 2631-77-8.mol |  |
| | 3,5-DIIODOSALICYLALDEHYDE Chemical Properties |
| Melting point | 109-110 °C (lit.) | | Boiling point | 304.6±42.0 °C(Predicted) | | density | 2.602±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder to crystal | | pka | 6.12±0.23(Predicted) | | color | White to Yellow to Green | | Water Solubility | Insoluble in water. | | λmax | 360nm(MCH)(lit.) | | Sensitive | Air & Light Sensitive | | BRN | 1102552 | | InChI | InChI=1S/C7H4I2O2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-3,11H | | InChIKey | MYWSBJKVOUZCIA-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(I)=CC(I)=C1O | | CAS DataBase Reference | 2631-77-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29130000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,5-DIIODOSALICYLALDEHYDE Usage And Synthesis |
| Uses | 3,5-Diiodosalicylaldehyde is used to synthesize new Schiff bases, (2,4-diiodo-6-[(2-morpholin-4-yl-ethylimino)-methyl]-phenol and 2,4-diiodo-6-[(3-morpholin-4-yl-propylimino)-methyl]-phenol) and the new tridentate ligand, [(2-hydroxy-3,5-diiodo-benzylidene)-amino]-acetic acid (HDBA), 3-bromo-N-(2-hydroxy-3,5-diiodobenzylidene)benzohydrazide monohydrate. |
| | 3,5-DIIODOSALICYLALDEHYDE Preparation Products And Raw materials |
|