- Cinosulfuron
-
- $1.00
-
2020-02-19
- CAS:94593-91-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kgs
|
| | Cinosulfuron Basic information |
| Product Name: | Cinosulfuron | | Synonyms: | SETOFF;1-[2-(2-Methoxyethoxy)phenylsulfonyl]-3-(4,6-dimethoxy-1,3,5-triazine-2-yl)urea;Cinosulfuorn;Benzenesulfonamide, N-(((4,6-dimethoxy-1,3,5-triazin-2-yl)amino)carbonyl)-2-(2-methoxyethoxy)-;Cinosulfuron [iso];Cinosulfuron 100mg [94593-91-6];Cinosulfuron 0;N-[[(4,6-Dimethoxy-1,3,5-triazin-2-yl)amino]carbonyl]-2-(2-methoxyethoxy)benzenesulfonamide | | CAS: | 94593-91-6 | | MF: | C15H19N5O7S | | MW: | 413.41 | | EINECS: | | | Product Categories: | Pesticides&Metabolites;Urea structure;Alpha sort;C;CAlphabetic;CI - CLPesticides&Metabolites;Herbicides;HERBICIDE | | Mol File: | 94593-91-6.mol |  |
| | Cinosulfuron Chemical Properties |
| Melting point | 140-145°C | | Boiling point | 224°C (rough estimate) | | density | 1.4192 (rough estimate) | | refractive index | 1.6460 (estimate) | | Fp | 144 °C | | storage temp. | 0-6°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 4.23±0.10(Predicted) | | color | White to Off-White | | BRN | 8162781 | | Major Application | agriculture
environmental | | InChI | 1S/C15H19N5O7S/c1-24-8-9-27-10-6-4-5-7-11(10)28(22,23)20-13(21)16-12-17-14(25-2)19-15(18-12)26-3/h4-7H,8-9H2,1-3H3,(H2,16,17,18,19,20,21) | | InChIKey | WMLPCIHUFDKWJU-UHFFFAOYSA-N | | SMILES | COCCOc1ccccc1S(=O)(=O)NC(=O)Nc2nc(OC)nc(OC)n2 | | CAS DataBase Reference | 94593-91-6(CAS DataBase Reference) | | EPA Substance Registry System | Cinosulfuron (94593-91-6) |
| WGK Germany | 2 | | RTECS | DB2070000 | | HS Code | 29350090 | | Storage Class | 11 - Combustible Solids |
| | Cinosulfuron Usage And Synthesis |
| Description | Cinosulfuron is a broad-spectrum herbicide. It has a high aqueous solubility, low volatility, is not normally persistent in soil systems but may be mobile and so may, under some circumstances, leach to groundwater. It tends to have a low to moderate toxicity to biodiversity. It has a low mammalian toxicity. | | Uses | Cinosulfuron is a pesticide. | | Definition | ChEBI: Cinosulfuron is an aromatic ether. | | Production Methods | Cinosulfuron is produced commercially through a multi-step synthesis that relies heavily on the intermediate compound 2-amino-4,6-dimethoxy-1,3,5-triazine. The process begins with the preparation of this triazine derivative, which is then coupled with a chlorinated benzenesulfonyl isocyanate to form the sulfonylurea linkage. This reaction typically takes place under controlled conditions using organic solvents and catalysts to ensure high yield and purity. The resulting compound, cinosulfuron, is then purified and formulated. | | Mechanism of action | Absorbed by shoots and roots, acts by inhibiting growth. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS | | Pesticide Type | Herbicide |
| | Cinosulfuron Preparation Products And Raw materials |
|