|
|
| | (R)-(-)-1-METHOXY-2-PROPANOL Basic information |
| Product Name: | (R)-(-)-1-METHOXY-2-PROPANOL | | Synonyms: | 2-Propanol, 1-Methoxy-,(2R)-;(R)-(-)-1-Methoxy-2-propanol;4-methoxy-3-(1-piperidinylmethyl)benzoic acid;(R)-2-HYDROXY-1-METHOXYPROPANE;(R)-(-)-1-METHOXY-2-PROPANOL;(R)-1-METHOXY-2-PROPANOL;(R)-(+)-PROPYLENE GLYCOL 1-METHYL ETHER;(R)-(-)-1-Methoxy-2-propanol, 98+% | | CAS: | 4984-22-9 | | MF: | C4H10O2 | | MW: | 90.12 | | EINECS: | 628-460-3 | | Product Categories: | Chiral Compound;CHIRAL COMPOUNDS;chiral | | Mol File: | 4984-22-9.mol |  |
| | (R)-(-)-1-METHOXY-2-PROPANOL Chemical Properties |
| Melting point | -97 °C | | Boiling point | 119-121 °C (lit.) | | density | 0.921 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.403 | | Fp | 33 °C | | storage temp. | Sealed in dry,2-8°C | | form | Liquid | | pka | 14.49±0.20(Predicted) | | color | Clear colorless | | Optical Rotation | [α]20/D 22±2°, c = 10% in chloroform | | BRN | 1718941 | | InChI | InChI=1S/C4H10O2/c1-4(5)3-6-2/h4-5H,3H2,1-2H3/t4-/m1/s1 | | InChIKey | ARXJGSRGQADJSQ-SCSAIBSYSA-N | | SMILES | C(OC)[C@H](O)C | | CAS DataBase Reference | 4984-22-9(CAS DataBase Reference) |
| Hazard Codes | F,Xn | | Risk Statements | 10-15 | | Safety Statements | 24-43-7/8 | | RIDADR | UN 3092 3/PG 3 | | WGK Germany | 1 | | HazardClass | 3 | | PackingGroup | Ⅲ | | HS Code | 29051990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | (R)-(-)-1-METHOXY-2-PROPANOL Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | (R)-(-)-1-Methoxy-2-propanol can be used as a reactant to prepare:
- (S)-3-(ethoxycarbonyl)-5-((1-methoxypropan-2-yl)oxy)benzoic acid, a key intermediate to synthesize phenylethyl benzamide derivatives, which can be used as glucokinase activators.
- Chiral pyrazolopyrimidinone derivatives as potential phosphodiesterase enzyme (PDE5) inhibitors.
- Aryl or alkyl ethers via etherification reaction.
| | General Description | (R)-(-)-1-Methoxy-2-propanol is a chiral secondary alcohol. It is formed during the hydrolysis of (R)-1-methoxy-2-propyl-acetate in the presence of Candida antarctica lipase B. |
| | (R)-(-)-1-METHOXY-2-PROPANOL Preparation Products And Raw materials |
|