| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Amino-4-methylphenylboronic acid hydrochloride Basic information |
| | 3-Amino-4-methylphenylboronic acid hydrochloride Chemical Properties |
| Melting point | 250°C | | Boiling point | 367.6±52.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder to crystaline | | pka | 8.77±0.10(Predicted) | | color | White to Gray to Brown | | InChI | InChI=1S/C7H10BNO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4,10-11H,9H2,1H3 | | InChIKey | PLTGUDDQNWJILD-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(C)C(N)=C1)(O)O | | CAS DataBase Reference | 22237-12-3(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 29310095 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ALFA
| English |
| | 3-Amino-4-methylphenylboronic acid hydrochloride Usage And Synthesis |
| Uses | 3-Amino-4-methylphenylboronic acid, HCl |
| | 3-Amino-4-methylphenylboronic acid hydrochloride Preparation Products And Raw materials |
|