| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
Tert-butyldicyclohexylphosphine tetrafluoroborate manufacturers
|
| | Tert-butyldicyclohexylphosphine tetrafluoroborate Basic information |
| Product Name: | Tert-butyldicyclohexylphosphine tetrafluoroborate | | Synonyms: | Tert-butyldicyclohexylphosphine tetrafluoroborate;Dicyclohexyl(1,1-dimethylethyl)phosphine tetrafluoroborate(1-);Bis(tiphenylphosphine)palladium chloride;Tert-butyldicyclohexylphosphine tetrafluoroborate(2-METHYL-3-OXAHEXANOIC) ACID | | CAS: | 1327162-47-9 | | MF: | C16H31BF4P- | | MW: | 341.1957138 | | EINECS: | | | Product Categories: | | | Mol File: | 1327162-47-9.mol |  |
| | Tert-butyldicyclohexylphosphine tetrafluoroborate Chemical Properties |
| InChI | InChI=1S/C16H31P.BF4/c1-16(2,3)17(14-10-6-4-7-11-14)15-12-8-5-9-13-15;2-1(3,4)5/h14-15H,4-13H2,1-3H3;/q;-1 | | InChIKey | XOMLPCCNVCCMRG-UHFFFAOYSA-N | | SMILES | [B-](F)(F)(F)F.P(C(C)(C)C)(C1CCCCC1)C1CCCCC1 |
| | Tert-butyldicyclohexylphosphine tetrafluoroborate Usage And Synthesis |
| | Tert-butyldicyclohexylphosphine tetrafluoroborate Preparation Products And Raw materials |
|