| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | tert-Butyldiphenylphosphine Basic information |
| | tert-Butyldiphenylphosphine Chemical Properties |
| Melting point | 52-55 °C(lit.) | | Boiling point | 144-146 °C2 mm Hg(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | crystal | | color | white | | InChI | InChI=1S/C16H19P/c1-16(2,3)17(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3 | | InChIKey | QZUPHAGRBBOLTB-UHFFFAOYSA-N | | SMILES | P(C(C)(C)C)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Risk Statements | 22-36/37/38 | | Safety Statements | 26-37 | | WGK Germany | 3 | | TSCA | No | | Storage Class | 10 - Combustible liquids |
| | tert-Butyldiphenylphosphine Usage And Synthesis |
| Uses | New family of Ph2(t-Bu)P phosphines for efficient Silyl-Heck transformations. | | Uses | Catalyst for:
- Nickel/Lewis acid-catalyzed carbocyanation of alkynes with acetonitrile or substituted acetonitriles
- Palladium catalyzed hydrocarboxylation of acetylene with carbon monoxide to acrylic acid under mild conditions
- Palladium to form a catalyst for methoxycarbonylation reactions
- Ru-catalyzed transfer hydrogenation in reductive coupling of disubstituted allenes with aldehydes
- Stereoselective silylation by dehydrogenative Si-O coupling with Si-stereogenic silanes
- Phosphine ligand in nickel-catalyzed carbocyanation of alkynes
- Monodentate P-Donor Ligands (LKB-P)
| | Definition | ChEBI: NSC 244302 is a member of benzenes. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand reaction type: Cross Couplings |
| | tert-Butyldiphenylphosphine Preparation Products And Raw materials |
|