|
|
| | t-Butyldicyclohexylphosphine Basic information |
| | t-Butyldicyclohexylphosphine Chemical Properties |
| Boiling point | 333.4±9.0 °C(Predicted) | | density | 0.939 g/mL at 25 °C(lit.) | | form | liquid | | color | colorless | | Sensitive | air sensitive | | InChI | InChI=1S/C16H31P/c1-16(2,3)17(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h14-15H,4-13H2,1-3H3 | | InChIKey | MQYZHXLHUNLBQH-UHFFFAOYSA-N | | SMILES | P(C1CCCCC1)(C1CCCCC1)C(C)(C)C |
| Hazard Codes | F | | Risk Statements | 17 | | Safety Statements | 6-16-27-36/37/39 | | RIDADR | UN 2845 4.2/PG 1 | | WGK Germany | 3 |
| | t-Butyldicyclohexylphosphine Usage And Synthesis |
| Chemical Properties |
t-Butyldicyclohexylphosphine is a colorless viscous liquid, it is sensitive to air and moisture. It reacts with strong oxidizing agents.
| | Uses | t-Butyldicyclohexylphosphine is an organic phosphine reagent used in organic synthesis and experimental research. | | Hazard |
t-Butyldicyclohexylphosphine causes skin and eye irritation. May cause respiratory irritation.
|
| | t-Butyldicyclohexylphosphine Preparation Products And Raw materials |
|