| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Diisobutyl fumarate
-
- $1.00
-
2020-01-13
- CAS:7283-69-4
- Min. Order: 1KG
- Purity: 85.0-99.8%
- Supply Ability: 200kgs
|
| | Diisobutyl fumarate Basic information |
| Product Name: | Diisobutyl fumarate | | Synonyms: | 2-Butenedioic acid (E)-, bis(2-methylpropyl) ester;Diisobutyl (2E)-2-butenedioate;Diisobutylester kyseliny fumarove;diisobutylesterkyselinyfumarove;Fumaric acid, diisobutyl ester;fumaricacid,diisobutylester;fumaricacidbis-(2-methylpropyl)ester;DIISOBUTYL FUMARATE | | CAS: | 7283-69-4 | | MF: | C12H20O4 | | MW: | 228.28 | | EINECS: | 230-706-6 | | Product Categories: | Plasticizers;Polymer Additives;Polymer Science | | Mol File: | 7283-69-4.mol |  |
| | Diisobutyl fumarate Chemical Properties |
| Melting point | 8 °C(lit.) | | Boiling point | 249 °C(lit.) | | density | 0.978 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.443(lit.) | | Fp | >230 °F | | storage temp. | 2-30°C | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.974~0.980 (20/4℃) | | InChI | 1S/C12H20O4/c1-9(2)7-15-11(13)5-6-12(14)16-8-10(3)4/h5-6,9-10H,7-8H2,1-4H3/b6-5+ | | InChIKey | RSRICHZMFPHXLE-AATRIKPKSA-N | | SMILES | CC(C)COC(=O)\C=C\C(=O)OCC(C)C | | NIST Chemistry Reference | Diisobutylfomarate(7283-69-4) |
| Hazard Codes | Xi | | Risk Statements | 38 | | Safety Statements | 24-26-36 | | WGK Germany | 3 | | RTECS | LT1565000 | | HS Code | 2917.19.1700 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Skin Irrit. 2 |
| | Diisobutyl fumarate Usage And Synthesis |
| Uses | Diisobutyl Fumarate is used in preparation of functional mixed plasticizer by variable pressure esterification. |
| | Diisobutyl fumarate Preparation Products And Raw materials |
|