| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (-)-DI[(1R)-MENTHYL] FUMARATE Basic information |
| Product Name: | (-)-DI[(1R)-MENTHYL] FUMARATE | | Synonyms: | (-)-DI[(1R)-MENTHYL] FUMARATE;Bis(2-isopropyl-5-methylcyclohexyl) (2E)-2-butenedioate;Menthol, fumarate (2:1), (1R,3R,4S)-;(E)-2-Butenedioic acid bis[(1R)-5β-methyl-2α-isopropylcyclohexan-1β-yl] ester;Fumaric acid bis[(1R)-2α-isopropyl-5β-methylcyclohexane-1β-yl] ester;Fumaric acid bis[(1R,1β,4S)-p-menthane-3β-yl] ester;Fumaric acid bis[(1R,1β,4α)-p-menthane-3β-yl] ester;Fumaric acid bis[(1R,2S,5R)-2-isopropyl-5-methylcyclohexyl] ester | | CAS: | 34675-24-6 | | MF: | C24H40O4 | | MW: | 392.57 | | EINECS: | | | Product Categories: | DID - DINChiral Building Blocks;Alphabetic;D;Esters;Organic Building Blocks | | Mol File: | 34675-24-6.mol | ![(-)-DI[(1R)-MENTHYL] FUMARATE Structure](CAS/GIF/34675-24-6.gif) |
| | (-)-DI[(1R)-MENTHYL] FUMARATE Chemical Properties |
| Melting point | 59-61 °C (lit.) | | Boiling point | 211 °C/5 mmHg (lit.) | | density | 0.9985 (rough estimate) | | refractive index | 1.4460 (estimate) | | form | Low Melting Solid or Powder | | color | Colorless to off-white | | Optical Rotation | [α]20/D 102°, c = 1 in chloroform | | BRN | 2568525 | | InChIKey | HTJZKHLYRXPLLS-NGHDTEGZSA-N | | SMILES | C[C@@H]1CC[C@@H](C(C)C)[C@@H](C1)OC(=O)\C=C\C(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (-)-DI[(1R)-MENTHYL] FUMARATE Usage And Synthesis |
| Uses | (-)-Dimenthyl Fumarate is used as a reagent in organic chemical synthesis of several compounds including that of pentacyclic steroids via tandem stille coupling. It was also used in synthesis of Lobucavir (L469360) which is an antiviral agent. |
| | (-)-DI[(1R)-MENTHYL] FUMARATE Preparation Products And Raw materials |
|