| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Cinidon-ethyl
CAS:142891-20-1
Purity:99% Package:10mg;100mg;1g
|
| Company Name: |
Shanghai Jiegu Biotechnology Co., Ltd.
|
| Tel: |
021-51698675 |
| Email: |
sales@jiejiegroup.com |
| Products Intro: |
Product Name:CINIDON-ETHYL
CAS:142891-20-1
Purity:97% HPLC Package:100KG;1KG
|
|
| | CINIDON-ETHYL Basic information |
| Product Name: | CINIDON-ETHYL | | Synonyms: | CINIDON-ETHYL;CIS-ETHYL 2-CHLORO-3-[2-CHLORO-5-(1,3,4,5,6,7-HEXAHYDRO-1,3-DIOXO-2H-ISOINDOL-2-YL)PHENYL]-2-PROPENOATE;cinidon-ethyl (iso);Cinidon-ethyl Standard;2-Propenoic acid, 2-chloro-3-[2-chloro-5-(1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]-, ethyl ester, (2Z)-;*Lindane Impurity 1 (α-HCH);C11667400 Cinidon-ethyl;Cinidon-ethyl 10.0 μg/ml Acetonitrile | | CAS: | 142891-20-1 | | MF: | C19H17Cl2NO4 | | MW: | 394.25 | | EINECS: | | | Product Categories: | | | Mol File: | 142891-20-1.mol |  |
| | CINIDON-ETHYL Chemical Properties |
| Boiling point | 573.7±50.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | 0-6°C | | pka | -2.16±0.20(Predicted) | | BRN | 8446817 | | Major Application | agriculture
environmental | | InChI | 1S/C19H17Cl2NO4/c1-2-26-19(25)16(21)10-11-9-12(7-8-15(11)20)22-17(23)13-5-3-4-6-14(13)18(22)24/h7-10H,2-6H2,1H3/b16-10- | | InChIKey | NNKKTZOEKDFTBU-YBEGLDIGSA-N | | SMILES | CCOC(=O)\C(Cl)=C\c1cc(ccc1Cl)N2C(=O)C3=C(CCCC3)C2=O |
| Hazard Codes | Xi,N | | Risk Statements | 43-50/53 | | Safety Statements | 36/37-60-61 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Carc. 2
Skin Sens. 1 |
| | CINIDON-ETHYL Usage And Synthesis |
| Uses | Herbicide. | | Definition | ChEBI: Cinidon ethyl is a carboxylic ester and organochlorine compound that is the ethyl ester of cinidon. It has a role as a herbicide. It is a member of isoindoles, a member of monochlorobenzenes and an ethyl ester. |
| | CINIDON-ETHYL Preparation Products And Raw materials |
|