- 3,4,5,6-Tetrahydrophthalimide
-
- $200.00 / 1KG
-
2025-09-25
- CAS:4720-86-9
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 3,4,5,6-Tetrahydrophthalimide Basic information |
| Product Name: | 3,4,5,6-Tetrahydrophthalimide | | Synonyms: | 1-Cyclohexene-1,2-dicarboximide;3,4,5,6-TETRAHYDROPHTHALIMIDE;DELTA1-Tetrahydrophthalimide;3,4,5,6-TETRAHYDROPHTHALIMIDE 96.0% [4720-86-9] C8H9NO2 FW151.16;4,5,6,7-Tetrahydro-1H-izoindol-1,3(2H)-dione;3,4,5,6-Tetrahydro
;3,4,5,6-tetrahydro-o-phthalimide;4,5,6,7-Tetrahydro-1H-isoindole-1,3(2H)-dione | | CAS: | 4720-86-9 | | MF: | C8H9NO2 | | MW: | 151.16 | | EINECS: | 225-211-7 | | Product Categories: | Diels-Alder Adducts | | Mol File: | 4720-86-9.mol |  |
| | 3,4,5,6-Tetrahydrophthalimide Chemical Properties |
| Melting point | 170-175 °C (sublm)(Solv: benzene (71-43-2)) | | Boiling point | 324.3±11.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 9.49±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H9NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h1-4H2,(H,9,10,11) | | InChIKey | AFJWMGOTLUUGHF-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(CCCC2)C(=O)N1 | | CAS DataBase Reference | 4720-86-9(CAS DataBase Reference) |
| | 3,4,5,6-Tetrahydrophthalimide Usage And Synthesis |
| Chemical Properties | slight yellow to white crystalline powder | | Uses | 3,4,5,6-Tetrahydrophthalimide is a useful research chemical compound used in the syntheses of novel N-(benzothiazol-5-yl)-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione and N-(benzothiazol-5-yl)isoindoline-1,3-dione as potent protoporphyrinogen oxidase Inhibitors. |
| | 3,4,5,6-Tetrahydrophthalimide Preparation Products And Raw materials |
|