|
|
| | 2,6-Dichloroisonicotinonitrile Basic information |
| Product Name: | 2,6-Dichloroisonicotinonitrile | | Synonyms: | 2,6-DICHLOROISONICOTINONITRILE;2,6-DICHLORO-4-CYANO-PYRIDINE;4-CYANO-2,6-DICHLOROPYRIDINE;2,6-Dichloro-4-pyridinecarbonitrile;2,6-Dichloropyridine-4-carbonitrile, 4-Cyano-2,6-dichloropyridine;2,6-dichloro-2-cyano-1,2-dihydropyridine-4-carboxylic acid;2,6-Dichloroisonicotinonitrile(WX636167);4-PYRIDINECARBONITRILE,2,6-DICHLORO | | CAS: | 32710-65-9 | | MF: | C6H2Cl2N2 | | MW: | 173 | | EINECS: | 604-596-9 | | Product Categories: | Pyridines | | Mol File: | 32710-65-9.mol |  |
| | 2,6-Dichloroisonicotinonitrile Chemical Properties |
| Melting point | 96 °C | | Boiling point | 239.4±35.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -4.76±0.10(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C6H2Cl2N2/c7-5-1-4(3-9)2-6(8)10-5/h1-2H | | InChIKey | BTUKLHWINORBTN-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(Cl)=CC(C#N)=C1 | | CAS DataBase Reference | 32710-65-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 20/21/22 | | Safety Statements | 26-36/37/39 | | RIDADR | 3439 | | Hazard Note | Irritant | | HS Code | 2933399990 |
| | 2,6-Dichloroisonicotinonitrile Usage And Synthesis |
| Uses | 2,6-Dichloroisonicotinonitrile is a pyridine compound with diverse chemical reactivity. It is mainly used as an organic synthesis intermediate and a synthetic raw material for pesticide molecules. It can be used in the preparation of pyridine organic ligands and pesticide molecules.
|
| | 2,6-Dichloroisonicotinonitrile Preparation Products And Raw materials |
| Raw materials | 2,6-dibromo-4-carboxamidopyridine-->2,6-Dichloroisonicotinamide-->2,6-DICHLOROPYRIDINE-4-CARBONYL CHLORIDE-->2,6-DICHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE-->4-Amino-2,6-dichloropyridine-->POTASSIUM CYANIDE-->ZINC CYANIDE-->2,6-Dichloroisonicotinic acid-->2,6-Dichloropyridine-->Thionyl chloride | | Preparation Products | 3,5-BIS(METHYLSULFONYL)ANILINE-->2-Chloro-6-(4-oxopiperidin-1-yl)isonicotinonitrile |
|