|
|
| | (Fluoromethyl)triphenylphosphonium tetrafluoroborate Basic information |
| Product Name: | (Fluoromethyl)triphenylphosphonium tetrafluoroborate | | Synonyms: | (Fluoromethyl)triphenylphosphonium tetrafluoroborate;(Fluoromethyl)triphenylphosphonium tetrafluoroborate(WXC06103);(monofluoromethyl)triphenylphosphonium tetrafluoroborate;P-(monofluoromethyl)triphenylphosphonium tetrafluoroborate;fluoromethyl(triphenyl)phosphonium;(R,r)-n-(2,4,6-trimethylbenzenesulphonyl)-1,2-;(Fluoromethyl)triphenylphosphonium tetrafluoroborate - [F90545];(fluoromethyl)triphenylphosphanium | | CAS: | 96385-23-8 | | MF: | C19H17BF5P | | MW: | 382.115057 | | EINECS: | | | Product Categories: | | | Mol File: | 96385-23-8.mol |  |
| | (Fluoromethyl)triphenylphosphonium tetrafluoroborate Chemical Properties |
| Melting point | 112-113 °C(Solv: ethyl ether (60-29-7); dichloromethane (75-09-2)) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C19H17FP.BF4/c20-16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;2-1(3,4)5/h1-15H,16H2;/q+1;-1 | | InChIKey | OTWRLIQGHGHSEI-UHFFFAOYSA-N | | SMILES | [P+](CF)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1.[B-](F)(F)(F)F |
| | (Fluoromethyl)triphenylphosphonium tetrafluoroborate Usage And Synthesis |
| Uses | (Fluoromethyl)triphenylphosphonium tetrafluoroborate is a chemical compound that is used as a reagent in organic synthesis reactions. It can be employed for the preparation of fluoroalkylated derivatives of alcohols, phenols, and carboxylic acids. |
| | (Fluoromethyl)triphenylphosphonium tetrafluoroborate Preparation Products And Raw materials |
|