| Company Name: |
PharmaBlock Sciences (Nanjing),Inc.
|
| Tel: |
025-86918202 4000255188 |
| Email: |
sales@pharmablock.com |
| Products Intro: |
Product Name:2-oxa-7-azaspiro[4.4]nonan-8-one
CAS:1384427-76-2
Purity:96.4 Package:100MG;250MG;1G;5G
|
| Company Name: |
Shanghai Run-Biotech Co., Ltd.
|
| Tel: |
021-57171705 13817537615 |
| Email: |
sales@run-biotech.com |
| Products Intro: |
Product Name:2-Oxa-7-azaspiro[4.4]Nonan-8-one
CAS:1384427-76-2
Purity:97% Package:25g;100g
|
| Company Name: |
Changzhou Hopschain Chemical Co.,Ltd.
|
| Tel: |
85528066 13775048983 |
| Email: |
sales@hopschem.com |
| Products Intro: |
Product Name:2-oxa-7-azaspiro[4.4]nonan-8-one
CAS:1384427-76-2
Purity:95+% Package:100mg;250mg;500mg;1g;2.5g;5g;10g
|
|
| | 2-Oxa-7-azaspiro[4.4]nonan-8-one Basic information |
| | 2-Oxa-7-azaspiro[4.4]nonan-8-one Chemical Properties |
| Boiling point | 354.7±35.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | pka | 16.18±0.20(Predicted) | | InChI | InChI=1S/C7H11NO2/c9-6-3-7(4-8-6)1-2-10-5-7/h1-5H2,(H,8,9) | | InChIKey | WSEWYUJJLXPJPW-UHFFFAOYSA-N | | SMILES | C1C2(CC(=O)NC2)CCO1 |
| | 2-Oxa-7-azaspiro[4.4]nonan-8-one Usage And Synthesis |
| Uses | 2-Oxa-7-azaspiro[4.4]nonan-8-one can be used as a building block in pharmaceutical synthesis.
|
| | 2-Oxa-7-azaspiro[4.4]nonan-8-one Preparation Products And Raw materials |
|