|
|
| | Z-L-Phe(4-tBu)-OH Basic information |
| Product Name: | Z-L-Phe(4-tBu)-OH | | Synonyms: | Z-L-Phe(4-tBu)-OH;CBZ-Phe(4-tBu)-OH;(2S)-2-{[(benzyloxy)carbonyl]amino}-3-(4-tert-butylphenyl)propanoic acid;L-Phenylalanine, 4-(1,1-dimethylethyl)-N-[(phenylmethoxy)carbonyl]-;N-Cbz-4-tert-butyl-L-phenylalanine;CBZ-L-Phe(4-tBu)-OH;[(phenylmethoxy);carbonylamino] | | CAS: | 1270292-81-3 | | MF: | C21H25NO4 | | MW: | 355.43 | | EINECS: | | | Product Categories: | | | Mol File: | 1270292-81-3.mol |  |
| | Z-L-Phe(4-tBu)-OH Chemical Properties |
| Boiling point | 534.4±50.0 °C(Predicted) | | density | 1.159±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.91±0.10(Predicted) | | InChI | InChI=1S/C21H25NO4/c1-21(2,3)17-11-9-15(10-12-17)13-18(19(23)24)22-20(25)26-14-16-7-5-4-6-8-16/h4-12,18H,13-14H2,1-3H3,(H,22,25)(H,23,24)/t18-/m0/s1 | | InChIKey | XBNNNROLVWMWES-SFHVURJKSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(C(C)(C)C)C=C1)NC(OCC1=CC=CC=C1)=O |
| | Z-L-Phe(4-tBu)-OH Usage And Synthesis |
| | Z-L-Phe(4-tBu)-OH Preparation Products And Raw materials |
|