|
|
| | Fmoc-L-4-tert-butyl-Phe Basic information |
| | Fmoc-L-4-tert-butyl-Phe Chemical Properties |
| Boiling point | 637.9±55.0 °C(Predicted) | | density | 1.198±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.81±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChIKey | OKEORFXNCSRZFL-VWLOTQADSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(C(C)(C)C)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| Hazard Codes | Xi | | HS Code | 2922498590 |
| | Fmoc-L-4-tert-butyl-Phe Usage And Synthesis |
| Chemical Properties | Off-white solid | | Uses | Fmoc-Phe(4-tBu)-OH is an amino acid derivative with an Fmoc protecting group, which can be used to synthesize rOicPaPhe(p-Me)-NH(2) with platelet aggregation activation inhibitory activity[1]. | | References | [1] Burke, et al. "Synthesis of novel peptide inhibitors of thrombin‐induced platelet activation." Chemical biology & drug design 68.5 (2006): 235-238. DOI:10.1111/j.1747-0285.2006.00442.x |
| | Fmoc-L-4-tert-butyl-Phe Preparation Products And Raw materials |
|