| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Boc-L-4-tert-butyl-Phe Basic information |
| | Boc-L-4-tert-butyl-Phe Chemical Properties |
| Boiling point | 461.4±40.0 °C(Predicted) | | density | 1.088±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.93±0.10(Predicted) | | Appearance | White to light yellow Solid | | Optical Rotation | 23°(C=0.01g/mI, ETOH, 20°C, 589nm) | | Major Application | peptide synthesis | | InChI | 1S/C18H27NO4/c1-17(2,3)13-9-7-12(8-10-13)11-14(15(20)21)19-16(22)23-18(4,5)6/h7-10,14H,11H2,1-6H3,(H,19,22)(H,20,21)/t14-/m0/s1 | | InChIKey | NGWQIBYYDHXJJR-AWEZNQCLSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(cc1)C(C)(C)C)C(O)=O |
| Hazard Codes | Xi | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Boc-L-4-tert-butyl-Phe Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-L-4-tert-butyl-Phe Preparation Products And Raw materials |
|