| Company Name: |
Nextpeptide Inc Gold |
| Tel: |
0571-81612335 13336028439 |
| Email: |
sales@nextpeptide.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Iodomesitylene diacetate manufacturers
|
| | Iodomesitylene diacetate Basic information | | Uses |
| Product Name: | Iodomesitylene diacetate | | Synonyms: | 2-(DIACETOXYIODO)MESITYLENE;2,4,6-TRIMETHYLIODOBENZENE DIACETATE;2-(Diacetoxyiodo)mesitylene
2,4,6-Trimethyl(diacetoxyiodo)benzene
2,4,6-Trimethyliodobenzene Diacetate;[acetyloxy-(2,4,6-trimethylphenyl)-$l^{3}-iodanyl] acetate;Bis(acetato-κO)(2,4,6-trimethylphenyl)iodine;IodomesityleneDiacetate>;Iodine, bis(acetato-κO)(2,4,6-trimethylphenyl)-;Mesityl-λ3-iodanediyl diacetate | | CAS: | 33035-41-5 | | MF: | C13H17IO4 | | MW: | 364.18 | | EINECS: | | | Product Categories: | Hypervalent Iodine Compounds;Oxidation;Synthetic Organic Chemistry | | Mol File: | 33035-41-5.mol |  |
| | Iodomesitylene diacetate Chemical Properties |
| Melting point | 168 °C | | storage temp. | Refrigerator | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C13H17IO4/c1-8-6-9(2)13(10(3)7-8)14(17-11(4)15)18-12(5)16/h6-7H,1-5H3 | | InChIKey | QFVRYGXAHXDPHE-UHFFFAOYSA-N | | SMILES | I(C1C(=CC(C)=CC=1C)C)(OC(=O)C)OC(=O)C |
| | Iodomesitylene diacetate Usage And Synthesis |
| Uses | Iodotrimethylphenylacetic acid ester can be used as a reagent in organic synthesis. |
| | Iodomesitylene diacetate Preparation Products And Raw materials |
|