- 1,3,5-Triisopropylbenzene
-
- $100.00 / 1KG
-
2025-09-25
- CAS:717-74-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 1,3,5-Triisopropylbenzene Basic information |
| Product Name: | 1,3,5-Triisopropylbenzene | | Synonyms: | 1,3,5-tris(1-methylethyl)-benzen;Benzene, 1,3,5-triisopropyl-;benzene,1,3,5-tris(1-methylethyl)-;1,3,5-TRIISOPROPYLBENZENE;1,3,5-TRIS(1-METHYLETHYL)BENZENE;1,3,5-TriisopropylbenzeneTriisopropylbenzene;1,3,5-Triisopropylbenzol;1,3,5-Tris(isopropyl)benzene | | CAS: | 717-74-8 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | 211-941-3 | | Product Categories: | Pyrimidines;Aromatic Hydrocarbons (substituted) & Derivatives;Arenes;Building Blocks;Organic Building Blocks;bc0001 | | Mol File: | 717-74-8.mol |  |
| | 1,3,5-Triisopropylbenzene Chemical Properties |
| Melting point | -14--11°C | | Boiling point | 232-236 °C (lit.) | | density | 0.845 g/mL at 25 °C (lit.) | | vapor pressure | 0.91Pa at 25℃ | | refractive index | n20/D 1.488(lit.) | | Fp | 188 °F | | storage temp. | Store below +30°C. | | form | Liquid | | color | Clear colorless | | Specific Gravity | 0.845 | | Water Solubility | Immiscible with water. | | BRN | 1862750 | | Henry's Law Constant | 2.5×10-4 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | InChI | 1S/C15H24/c1-10(2)13-7-14(11(3)4)9-15(8-13)12(5)6/h7-12H,1-6H3 | | InChIKey | VUMCUSHVMYIRMB-UHFFFAOYSA-N | | SMILES | CC(C)c1cc(cc(c1)C(C)C)C(C)C | | LogP | 6.68 at 24℃ | | CAS DataBase Reference | 717-74-8(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1,3,5-tris(1-methylethyl)-(717-74-8) | | EPA Substance Registry System | 1,3,5-Triisopropylbenzene (717-74-8) |
| Safety Statements | 23-24/25 | | RIDADR | NA1993 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | CBL | | HS Code | 29029080 | | Storage Class | 10 - Combustible liquids |
| | 1,3,5-Triisopropylbenzene Usage And Synthesis |
| Description | 1,3,5-Triisopropylbenzene is a versatile compound that has several applications in various industries. It is commonly used as a fuel and fuel additive, as well as in lubricants and lubricant additives. Additionally, it is utilized in the production of 2,4,6-triisopropyl-benzenesulfonyl chloride. This compound is also effective as a swelling agent in the synthesis of mesoporous silica with hexagonal pores. Furthermore, it serves as a micelle expander in the creation of magnetic mesoporous silica nanoparticles. | | Chemical Properties | Clear colorless liquid | | Uses | 1,3,5-Triisopropylbenzene can be usually used as swelling agent during the synthesis of mesoporous silicas with two-dimensional hexagonal pores,also used as micelle expander in the synthesis of highly ordered mesoporous SBA-15 silica and magnetic mesoporous silica nanoparticles. | | Uses | 1,3,5-Triisopropylbenzene is used as a micelle expander in hybrid periodic mesoporous organosilica designed to improve the properties of immobilized enzymes. | | Flammability and Explosibility | Not classified |
| | 1,3,5-Triisopropylbenzene Preparation Products And Raw materials |
| Raw materials | Ethyl acetate-->Diethyl ether-->Dichloromethane-->Magnesium sulfate-->Sodium chloride-->Benzene-->Aluminum chloride-->2-Bromopropane-->1,2,4-TRI-ISO-PROPYLBENZENE-->3-Methyl-1-butynyltrimethylsilane-->2,4,6-TRIBROMOIODOBENZENE-->2,4,6-TRIISOPROPYLBENZENEBORONIC ACID-->2,4,6-TRIISOPROPYLPHENYLBORONIC ACID MET-->3-METHYL-1-BUTYNE-->Dibenzylamine | | Preparation Products | X-PHOS-->2,4,6-Triisopropylbenzenesulfonyl chloride-->IODOMESITYLENE DIACETATE-->Cumene-->Benzene, 1,3,5-tris(1-methylethyl)-2-nitro- |
|