| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1-(4-tert-Butylbenzyl)piperazine Basic information |
| | 1-(4-tert-Butylbenzyl)piperazine Chemical Properties |
| Melting point | 52-56 °C | | Boiling point | 138-140°C 2mm | | density | 0.974±0.06 g/cm3(Predicted) | | pka | 9.16±0.10(Predicted) | | form | Solid | | color | Off-white to pale yellow | | Sensitive | Air Sensitive | | InChI | 1S/C15H24N2/c1-15(2,3)14-6-4-13(5-7-14)12-17-10-8-16-9-11-17/h4-7,16H,8-12H2,1-3H3 | | InChIKey | UQLCETYSARZZSR-UHFFFAOYSA-N | | SMILES | CC(C)(C)c1ccc(CN2CCNCC2)cc1 | | CAS DataBase Reference | 956-61-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Hazard Note | Irritant | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-(4-tert-Butylbenzyl)piperazine Usage And Synthesis |
| Uses | 1-(4-TERT-BUTYLBENZYL)PIPERAZINE can be used as a crucial intermediate in the synthesis of various pharmaceuticals. |
| | 1-(4-tert-Butylbenzyl)piperazine Preparation Products And Raw materials |
|