|
|
| | Dibenz[b,f]azepine-5-carbonyl chloride Basic information |
| | Dibenz[b,f]azepine-5-carbonyl chloride Chemical Properties |
| Melting point | 149-153 °C (lit.) | | Boiling point | 413.7±38.0 °C(Predicted) | | density | 1.316±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Chloroform, Dichloromethane, Ethyl Acetate | | form | Oil | | pka | -3.69±0.20(Predicted) | | color | Brown | | InChI | InChI=1S/C15H10ClNO/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17/h1-10H | | InChIKey | APJYHXJGXDPGBA-UHFFFAOYSA-N | | SMILES | C(Cl)(N1C2=CC=CC=C2C=CC2=CC=CC=C12)=O | | CAS DataBase Reference | 33948-22-0(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Dibenz[b,f]azepine-5-carbonyl chloride Usage And Synthesis |
| Chemical Properties | Pink Solid | | Uses | Dibenz [b,f]azepine-5-carbonyl chloride may be used in the preparation of trans-10,11-dibromo-10,11-dihydro-5H-dibenz[b,f]azepine-5-carbonyl chloride via bromination using bromine. It may also be used to prepare urea derivatives, which are potent P2X4 receptor (purinergic receptor) antagonists. | | Uses | An intermediate in the preparation of Carbamazepine. | | General Description | Dibenz [b,f]azepine-5-carbonyl chloride or 5H-dibenz [b,f]azepine-5-carbonyl chloride is a tricyclic heterocyclic compound that can be synthesized from 5H-dibenz[ b,f]azepine. |
| | Dibenz[b,f]azepine-5-carbonyl chloride Preparation Products And Raw materials |
|