|
|
| | Dichloro(o-isopropoxyphenylmethylene)(tricyclohexylphosphine)ruthenium(II) Basic information |
| Product Name: | Dichloro(o-isopropoxyphenylmethylene)(tricyclohexylphosphine)ruthenium(II) | | Synonyms: | RUTHENIUM, DICHLORO[[2-(1-METHYLETHOXY)PHENYL]METHYLENE](TRICYCLOHEXYLPHOSPHINE);Dichloro[[2-(1-methylethoxy-O)phenyl]methylene](tricyclohexylphosphine)ruthenium;DICHLORO(O-ISOPROPOXYPHENYLMETHYLENE) &;Dichloro(2-isopropoxyphenylmethylene)(tricyclohexylphosphine)ruthenium (II);Hoveyda-Grubbs Catalyst 1st Generation,Dichloro(o-isopropoxyphenylmethylene)(tricyclohexylphosphine)ruthenium(II);RutheniuM,dichloro[[2-(1-Methylethoxy-kO)phenyl]Methylene-kC](tricyclohexylphosphine)-,(SP-5-41)-;Dichloro(2-isopropoxyphenylMethylene)(tricyclohexylphosphine)rutheniuM (II) (Hoveyda-Grubbs Catalyst 1st Generation);Hoveyda-Grubbs Catalyst 1st Generation | | CAS: | 203714-71-0 | | MF: | C28H45Cl2OPRu | | MW: | 600.61 | | EINECS: | 692-988-0 | | Product Categories: | Ru | | Mol File: | 203714-71-0.mol |  |
| | Dichloro(o-isopropoxyphenylmethylene)(tricyclohexylphosphine)ruthenium(II) Chemical Properties |
| Melting point | 195-197 °C(lit.) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | Very Dark Purple | | InChI | 1S/C18H33P.C10H12O.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-8(2)11-10-7-5-4-6-9(10)3;;;/h16-18H,1-15H2;3-8H,1-2H3;2*1H;/q;;;;+2/p-2 | | InChIKey | KMKCJXPECJFQPQ-UHFFFAOYSA-L | | SMILES | P(C1CCCCC1)(C1CCCCC1)C1CCCCC1.C1(C=[Ru](Cl)Cl)=CC=CC=C1OC(C)C |
| Hazard Codes | F | | Risk Statements | 11 | | RIDADR | UN1325 - class 4.1 - PG 2 - Flammable solids, organic, n.o.s., HI: all | | WGK Germany | 3 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Flam. Sol. 2 |
| | Dichloro(o-isopropoxyphenylmethylene)(tricyclohexylphosphine)ruthenium(II) Usage And Synthesis |
| Uses | Proven to be useful in Ring-Closing Metathesis (RCM) to form macrocycles. Also employed in a pivotal, macrocyclic ring-closing metathesis in the multi-step synthesis of an HCV protease inhibitor. | | reaction suitability | core: ruthenium
reagent type: catalyst
reaction type: Ring Opening Metathesis Polymerisation |
| | Dichloro(o-isopropoxyphenylmethylene)(tricyclohexylphosphine)ruthenium(II) Preparation Products And Raw materials |
|