|
|
| | 6-CHLORO-1,3-BENZOXAZOL-2(3H)-ONE Basic information |
| | 6-CHLORO-1,3-BENZOXAZOL-2(3H)-ONE Chemical Properties |
| Melting point | 192 °C | | density | 1.3771 (rough estimate) | | refractive index | 1.5557 (estimate) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 8.34±0.70(Predicted) | | form | Crystalline Powder | | color | Light beige | | InChI | InChI=1S/C7H4ClNO2/c8-4-1-2-5-6(3-4)11-7(10)9-5/h1-3H,(H,9,10) | | InChIKey | MATCZHXABVLZIE-UHFFFAOYSA-N | | SMILES | O1C2=CC(Cl)=CC=C2NC1=O | | CAS DataBase Reference | 19932-84-4(CAS DataBase Reference) | | EPA Substance Registry System | 2(3H)-Benzoxazolone, 6-chloro- (19932-84-4) |
| | 6-CHLORO-1,3-BENZOXAZOL-2(3H)-ONE Usage And Synthesis |
| Chemical Properties | light beige crystalline powder | | Uses | 6-Chloro-1,3-Benzoxazol-2(3H)-One is used in preparation of substituted triazoles as potent ABA receptor pan-antagonists. |
| | 6-CHLORO-1,3-BENZOXAZOL-2(3H)-ONE Preparation Products And Raw materials |
|